Diethyl (5-nitrobenzofuran-2-carbonyl)glycyl-L-valyl-D-glutamate

ID: ALA5184105

PubChem CID: 168280935

Max Phase: Preclinical

Molecular Formula: C27H34N4O10

Molecular Weight: 574.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1cc2cc([N+](=O)[O-])ccc2o1)C(C)C)C(=O)OCC

Standard InChI:  InChI=1S/C27H34N4O10/c1-5-39-24(34)12-9-20(27(36)40-6-2)29-26(35)25(16(3)4)30-23(33)15-28-22(32)11-8-19-14-17-13-18(31(37)38)7-10-21(17)41-19/h7-8,10-11,13-14,16,20,25H,5-6,9,12,15H2,1-4H3,(H,28,32)(H,29,35)(H,30,33)/b11-8+/t20-,25+/m1/s1

Standard InChI Key:  XRJQPPIKIXGBIV-WTNLZWJLSA-N

Molfile:  

 
     RDKit          2D

 41 42  0  0  0  0  0  0  0  0999 V2000
   -2.0609    0.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3464    0.6257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0609   -0.6121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7756    0.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4903    0.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2050    0.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6317    0.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0829    0.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7976    0.2130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0829    1.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5123    0.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2270    0.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5123    1.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417    0.6257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2270   -0.6121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6564    0.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3711    0.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0858    0.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8005    0.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5152    0.2130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2299    0.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6564   -0.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3711   -1.0248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417   -1.0248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3711   -1.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7038   -2.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9835    0.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8005    1.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2270    1.8635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7976    1.8635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9585    0.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5105    0.9033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0981    1.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2912    1.4461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3329    0.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7456    1.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3368    2.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5124    2.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5708    1.6182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9835    0.9035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9835    2.3329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  2  0
  5  6  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 11 13  1  1
 12 14  1  0
 12 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16 22  1  6
 22 23  1  0
 22 24  2  0
 23 25  1  0
 26 25  1  0
 27 21  1  0
 19 28  2  0
 29 13  1  0
 13 30  1  0
 31  6  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34  6  1  0
 32 35  1  0
 36 35  2  0
 37 36  1  0
 38 37  2  0
 33 38  1  0
 36 39  1  0
 39 40  1  0
 39 41  2  0
M  CHG  2  39   1  40  -1
M  END

Alternative Forms

  1. Parent:

    ALA5184105

    ---

Associated Targets(Human)

NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 574.59Molecular Weight (Monoisotopic): 574.2275AlogP: 2.00#Rotatable Bonds: 15
Polar Surface Area: 196.18Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.73CX Basic pKa: CX LogP: 1.52CX LogD: 1.52
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.12Np Likeness Score: -0.60

References

1. Guzelj S, Bizjak Š, Jakopin Ž..  (2022)  Discovery of Desmuramylpeptide NOD2 Agonists with Single-Digit Nanomolar Potency.,  13  (8.0): [PMID:35978688] [10.1021/acsmedchemlett.2c00121]

Source