1,1'-(9H-xanthene-2,7-diyl)bis(2-(dimethylamino)ethan-1-one)

ID: ALA5184260

PubChem CID: 37877

Max Phase: Preclinical

Molecular Formula: C21H24N2O3

Molecular Weight: 352.43

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CC(=O)c1ccc2c(c1)Cc1cc(C(=O)CN(C)C)ccc1O2

Standard InChI:  InChI=1S/C21H24N2O3/c1-22(2)12-18(24)14-5-7-20-16(9-14)11-17-10-15(6-8-21(17)26-20)19(25)13-23(3)4/h5-10H,11-13H2,1-4H3

Standard InChI Key:  MCGUIXIFIYPRRO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   -2.1416    0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4270    0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7151    0.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7151   -0.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4253   -1.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1416   -0.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005    0.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7140    0.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7140   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -1.2367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4267    0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1416   -0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4318   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8563    0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8563    1.2371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5709   -0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8563    0.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5709    0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8563    1.2383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2855    0.4119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0002   -0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2855    1.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2855    0.4132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0002    0.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2855    1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  4 10  1  0
  8 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 12 15  1  0
 15 16  2  0
 15 17  1  0
  1 18  1  0
 18 19  1  0
 18 20  2  0
 17 21  1  0
 21 22  1  0
 21 23  1  0
 19 24  1  0
 24 25  1  0
 24 26  1  0
M  END

Associated Targets(non-human)

Vaccinia virus (4609 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 352.43Molecular Weight (Monoisotopic): 352.1787AlogP: 2.87#Rotatable Bonds: 6
Polar Surface Area: 49.85Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.86CX LogP: 2.49CX LogD: 2.37
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.64Np Likeness Score: -0.25

References

1. Maia M, Resende DISP, Durães F, Pinto MMM, Sousa E..  (2021)  Xanthenes in Medicinal Chemistry - Synthetic strategies and biological activities.,  210  [PMID:33310284] [10.1016/j.ejmech.2020.113085]

Source