The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-Fluorophenyl)-4-(4-hydroxyphenyl)-1,3-diphenyl-1H-pyrazolo-[3,4-b]pyridine-5-carbonitrile ID: ALA5184279
PubChem CID: 168279853
Max Phase: Preclinical
Molecular Formula: C31H19FN4O
Molecular Weight: 482.52
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1c(-c2ccc(F)cc2)nc2c(c(-c3ccccc3)nn2-c2ccccc2)c1-c1ccc(O)cc1
Standard InChI: InChI=1S/C31H19FN4O/c32-23-15-11-22(12-16-23)29-26(19-33)27(20-13-17-25(37)18-14-20)28-30(21-7-3-1-4-8-21)35-36(31(28)34-29)24-9-5-2-6-10-24/h1-18,37H
Standard InChI Key: DEEPIAVUPICSMT-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
1.1296 -0.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4152 0.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1289 -0.9492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4141 -1.3618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2974 -0.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3022 -0.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0122 -2.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0120 -1.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7250 -2.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4396 -2.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4412 -1.3674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7295 -0.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9315 0.1219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4001 -0.5300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9091 -1.1950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0167 0.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7313 0.6967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5617 1.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1450 0.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7754 2.2967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5726 2.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1541 1.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9454 1.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9195 -2.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1226 -1.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1316 -3.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5481 -3.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7547 -3.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5366 -2.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4152 1.1110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2990 1.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2983 2.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4162 2.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1280 2.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1328 1.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4162 3.5840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1541 -2.6009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 1 2 0
4 3 1 0
5 4 2 0
2 6 2 0
6 5 1 0
7 8 2 0
8 5 1 0
9 7 1 0
10 9 2 0
11 10 1 0
8 12 1 0
12 11 2 0
1 13 1 0
13 14 2 0
15 14 1 0
3 15 1 0
6 16 1 0
16 17 3 0
18 19 2 0
19 13 1 0
20 18 1 0
21 20 2 0
22 21 1 0
19 23 1 0
23 22 2 0
24 25 2 0
25 15 1 0
26 24 1 0
27 26 2 0
28 27 1 0
25 29 1 0
29 28 2 0
30 2 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
30 35 1 0
35 34 2 0
33 36 1 0
10 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.52Molecular Weight (Monoisotopic): 482.1543AlogP: 7.14#Rotatable Bonds: 4Polar Surface Area: 74.73Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.70CX Basic pKa: 0.73CX LogP: 7.64CX LogD: 7.62Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.04
References 1. Barghash RF, Eldehna WM, Kovalová M, Vojáčková V, Kryštof V, Abdel-Aziz HA.. (2022) One-pot three-component synthesis of novel pyrazolo[3,4-b]pyridines as potent antileukemic agents., 227 [PMID:34731763 ] [10.1016/j.ejmech.2021.113952 ]