The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((S)-1-((S)-1-(5-(2,4-difluorophenoxy)pyrazin-2-ylamino)-1-oxopropan-2-yl)-4,4-difluoropiperidin-3-yl)pyridine 1-oxide ID: ALA5184300
PubChem CID: 164734529
Product Number: M612016, Order Now?
Max Phase: Preclinical
Molecular Formula: C23H21F4N5O3
Molecular Weight: 491.45
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](C(=O)Nc1cnc(Oc2ccc(F)cc2F)cn1)N1CCC(F)(F)[C@@H](c2cc[n+]([O-])cc2)C1
Standard InChI: InChI=1S/C23H21F4N5O3/c1-14(31-9-6-23(26,27)17(13-31)15-4-7-32(34)8-5-15)22(33)30-20-11-29-21(12-28-20)35-19-3-2-16(24)10-18(19)25/h2-5,7-8,10-12,14,17H,6,9,13H2,1H3,(H,28,30,33)/t14-,17+/m0/s1
Standard InChI Key: UOCITXUZOXOHLH-WMLDXEAASA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
2.7718 -1.0087 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0596 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7764 -1.8336 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.0382 4.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8610 4.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2751 3.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8677 2.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0418 2.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6313 3.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2825 2.1552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8727 1.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2924 0.7291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8833 0.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0579 0.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6433 0.7284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0548 1.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6225 4.9980 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.6471 -0.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8226 -0.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4118 -1.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4127 -1.4228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8256 -2.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4087 0.0071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8235 -2.1377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8266 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6511 -0.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6480 -2.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0588 -2.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6432 -3.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0533 -4.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8787 -4.2836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2924 -3.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8800 -2.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6304 2.1519 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.2905 -4.9980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
4 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 1 1
19 23 2 0
21 24 1 0
21 25 1 0
25 26 1 0
26 2 1 0
24 27 1 0
27 2 1 0
27 28 1 1
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
8 34 1 0
31 35 1 0
M CHG 2 31 1 35 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.45Molecular Weight (Monoisotopic): 491.1581AlogP: 3.63#Rotatable Bonds: 6Polar Surface Area: 94.29Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.17CX Basic pKa: 5.54CX LogP: 2.31CX LogD: 2.30Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -1.44