The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(5-(3-Morpholinopropyl)-2,3,4,5-tetrahydro-1H-benzo[b](1,4)diazepine-1-carbonyl)phenyl)furan-2-carboxamide ID: ALA5184594
PubChem CID: 168279559
Max Phase: Preclinical
Molecular Formula: C28H32N4O4
Molecular Weight: 488.59
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(C(=O)N2CCCN(CCCN3CCOCC3)c3ccccc32)cc1)c1ccco1
Standard InChI: InChI=1S/C28H32N4O4/c33-27(26-8-3-19-36-26)29-23-11-9-22(10-12-23)28(34)32-16-5-15-31(24-6-1-2-7-25(24)32)14-4-13-30-17-20-35-21-18-30/h1-3,6-12,19H,4-5,13-18,20-21H2,(H,29,33)
Standard InChI Key: MEYBZFHAPNGTQH-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-3.4572 0.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4572 -0.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7427 -0.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0281 -0.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3830 -0.7087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5666 -1.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3550 -1.7564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9618 -2.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1454 -2.8787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5405 -3.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2477 -3.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8526 -3.7580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6410 -3.5148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8246 -2.7103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2458 -4.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1473 -4.8951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8960 -5.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4572 -4.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0554 -3.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4313 -2.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1734 -1.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5786 -0.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2206 0.2181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5786 0.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3830 1.1451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5666 1.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9618 2.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1454 3.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5405 3.8763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2477 3.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8526 4.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6689 4.9988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1193 5.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7241 4.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0281 0.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7427 1.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
16 15 1 0
17 16 1 0
18 17 2 0
19 15 2 0
19 18 1 0
11 20 2 0
20 21 1 0
21 8 2 0
5 22 1 0
23 22 1 0
24 23 1 0
25 24 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 29 1 0
35 25 1 0
4 35 2 0
35 36 1 0
36 1 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.59Molecular Weight (Monoisotopic): 488.2424AlogP: 4.11#Rotatable Bonds: 7Polar Surface Area: 78.26Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.76CX Basic pKa: 7.11CX LogP: 2.94CX LogD: 2.76Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.54Np Likeness Score: -1.80
References 1. Cao X, Wang P, Yuan H, Zhang H, He Y, Fu K, Fang Q, Liu H, Su L, Yin L, Xu P, Xie Y, Xiong X, Wang J, Zhu X, Guo D.. (2022) Benzodiazepine Derivatives as Potent Vasopressin V2 Receptor Antagonists for the Treatment of Autosomal Dominant Kidney Disease., 65 (13.0): [PMID:35579344 ] [10.1021/acs.jmedchem.2c00567 ]