N-(4-(5-(3-Morpholinopropyl)-2,3,4,5-tetrahydro-1H-benzo[b](1,4)diazepine-1-carbonyl)phenyl)furan-2-carboxamide

ID: ALA5184594

PubChem CID: 168279559

Max Phase: Preclinical

Molecular Formula: C28H32N4O4

Molecular Weight: 488.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(C(=O)N2CCCN(CCCN3CCOCC3)c3ccccc32)cc1)c1ccco1

Standard InChI:  InChI=1S/C28H32N4O4/c33-27(26-8-3-19-36-26)29-23-11-9-22(10-12-23)28(34)32-16-5-15-31(24-6-1-2-7-25(24)32)14-4-13-30-17-20-35-21-18-30/h1-3,6-12,19H,4-5,13-18,20-21H2,(H,29,33)

Standard InChI Key:  MEYBZFHAPNGTQH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -3.4572    0.6306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4572   -0.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7427   -0.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0281   -0.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3830   -0.7087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5666   -1.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3550   -1.7564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9618   -2.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1454   -2.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5405   -3.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2477   -3.1967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8526   -3.7580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6410   -3.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8246   -2.7103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2458   -4.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1473   -4.8951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8960   -5.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4572   -4.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0554   -3.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4313   -2.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1734   -1.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5786   -0.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2206    0.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5786    0.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3830    1.1451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5666    1.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9618    2.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1454    3.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5405    3.8763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2477    3.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8526    4.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6689    4.9988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1193    5.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7241    4.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0281    0.6306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7427    1.0432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  2  0
 19 15  2  0
 19 18  1  0
 11 20  2  0
 20 21  1  0
 21  8  2  0
  5 22  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 29  1  0
 35 25  1  0
  4 35  2  0
 35 36  1  0
 36  1  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5184594

    ---

Associated Targets(Human)

AVPR2 Tclin Vasopressin V2 receptor (2912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.59Molecular Weight (Monoisotopic): 488.2424AlogP: 4.11#Rotatable Bonds: 7
Polar Surface Area: 78.26Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.76CX Basic pKa: 7.11CX LogP: 2.94CX LogD: 2.76
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.54Np Likeness Score: -1.80

References

1. Cao X, Wang P, Yuan H, Zhang H, He Y, Fu K, Fang Q, Liu H, Su L, Yin L, Xu P, Xie Y, Xiong X, Wang J, Zhu X, Guo D..  (2022)  Benzodiazepine Derivatives as Potent Vasopressin V2 Receptor Antagonists for the Treatment of Autosomal Dominant Kidney Disease.,  65  (13.0): [PMID:35579344] [10.1021/acs.jmedchem.2c00567]

Source