ID: ALA5184645

PubChem CID: 168281736

Max Phase: Preclinical

Molecular Formula: C27H24N6O3

Molecular Weight: 480.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCc1ccnc2ccccc12)c1ccc2cc1OCCOCCNc1ccn3ncc-2c3n1

Standard InChI:  InChI=1S/C27H24N6O3/c34-27(30-16-19-7-9-28-23-4-2-1-3-20(19)23)21-6-5-18-15-24(21)36-14-13-35-12-10-29-25-8-11-33-26(32-25)22(18)17-31-33/h1-9,11,15,17H,10,12-14,16H2,(H,29,32)(H,30,34)

Standard InChI Key:  IOYIAKFKAVIRKA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   -2.5340    2.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8195    3.2189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1051    2.8064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1051    1.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8195    1.5689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5340    1.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3206    1.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3206    3.0613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1642    2.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2482    1.5690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2482    0.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9625    0.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9625   -0.4927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2482   -0.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5340   -0.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8197   -0.9051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3206    0.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3935    0.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3927   -0.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3216   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0331   -0.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0378    0.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3216   -1.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3925   -1.9826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0358   -1.9826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1068   -1.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8210   -1.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5354   -1.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2471   -1.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2471   -2.8072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5372   -3.2189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8210   -2.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5367   -0.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2492   -0.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9582   -0.7481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9625   -1.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  2  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  7 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 21 16  1  0
 22 21  2  0
 17 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 28 33  1  0
 34 33  2  0
 35 34  1  0
 36 35  2  0
 29 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5184645

    ---

Associated Targets(Human)

STK17B Tchem Serine/threonine-protein kinase 17B (773 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.53Molecular Weight (Monoisotopic): 480.1910AlogP: 3.70#Rotatable Bonds: 3
Polar Surface Area: 102.67Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.74CX Basic pKa: 4.40CX LogP: 2.95CX LogD: 2.95
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: -1.23

References

1. Kurz CG, Preuss F, Tjaden A, Cusack M, Amrhein JA, Chatterjee D, Mathea S, Berger LM, Berger BT, Krämer A, Weller M, Weiss T, Müller S, Knapp S, Hanke T..  (2022)  Illuminating the Dark: Highly Selective Inhibition of Serine/Threonine Kinase 17A with Pyrazolo[1,5-a]pyrimidine-Based Macrocycles.,  65  (11.0): [PMID:35608370] [10.1021/acs.jmedchem.2c00173]

Source