The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5184645
PubChem CID: 168281736
Max Phase: Preclinical
Molecular Formula: C27H24N6O3
Molecular Weight: 480.53
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccnc2ccccc12)c1ccc2cc1OCCOCCNc1ccn3ncc-2c3n1
Standard InChI: InChI=1S/C27H24N6O3/c34-27(30-16-19-7-9-28-23-4-2-1-3-20(19)23)21-6-5-18-15-24(21)36-14-13-35-12-10-29-25-8-11-33-26(32-25)22(18)17-31-33/h1-9,11,15,17H,10,12-14,16H2,(H,29,32)(H,30,34)
Standard InChI Key: IOYIAKFKAVIRKA-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
-2.5340 2.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8195 3.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1051 2.8064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1051 1.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8195 1.5689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5340 1.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3206 1.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3206 3.0613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1642 2.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2482 1.5690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2482 0.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9625 0.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9625 -0.4927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2482 -0.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5340 -0.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8197 -0.9051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3206 0.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3935 0.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3927 -0.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3216 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0331 -0.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0378 0.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3216 -1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3925 -1.9826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0358 -1.9826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1068 -1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8210 -1.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5354 -1.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2471 -1.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2471 -2.8072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5372 -3.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8210 -2.8109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5367 -0.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2492 -0.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9582 -0.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9625 -1.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 2 0
3 8 1 0
8 9 2 0
9 7 1 0
6 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
7 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
21 16 1 0
22 21 2 0
17 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
28 33 1 0
34 33 2 0
35 34 1 0
36 35 2 0
29 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.53Molecular Weight (Monoisotopic): 480.1910AlogP: 3.70#Rotatable Bonds: 3Polar Surface Area: 102.67Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.74CX Basic pKa: 4.40CX LogP: 2.95CX LogD: 2.95Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: -1.23
References 1. Kurz CG, Preuss F, Tjaden A, Cusack M, Amrhein JA, Chatterjee D, Mathea S, Berger LM, Berger BT, Krämer A, Weller M, Weiss T, Müller S, Knapp S, Hanke T.. (2022) Illuminating the Dark: Highly Selective Inhibition of Serine/Threonine Kinase 17A with Pyrazolo[1,5-a ]pyrimidine-Based Macrocycles., 65 (11.0): [PMID:35608370 ] [10.1021/acs.jmedchem.2c00173 ]