The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((bromodichloromethyl)sulfonyl)-N-cyclohexylaniline ID: ALA5184821
PubChem CID: 168283008
Max Phase: Preclinical
Molecular Formula: C13H16BrCl2NO2S
Molecular Weight: 401.15
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccc(NC2CCCCC2)cc1)C(Cl)(Cl)Br
Standard InChI: InChI=1S/C13H16BrCl2NO2S/c14-13(15,16)20(18,19)12-8-6-11(7-9-12)17-10-4-2-1-3-5-10/h6-10,17H,1-5H2
Standard InChI Key: XXSJQVGLTPUTKX-UHFFFAOYSA-N
Molfile:
RDKit 2D
20 21 0 0 0 0 0 0 0 0999 V2000
-1.0705 1.1828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3560 0.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3560 -0.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3603 -0.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 -0.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 0.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3585 1.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7850 -0.4670 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.4995 -0.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4995 0.7705 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2140 0.3579 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.2140 -0.4670 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.3717 -1.1828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1967 -1.1828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7851 0.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7851 -0.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4996 -0.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2140 -0.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2140 0.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4996 1.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 2 2 0
5 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
9 12 1 0
8 13 2 0
8 14 2 0
1 15 1 0
16 15 1 0
17 16 1 0
18 17 1 0
19 18 1 0
20 19 1 0
15 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.15Molecular Weight (Monoisotopic): 398.9462AlogP: 4.69#Rotatable Bonds: 4Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.89CX LogP: 4.96CX LogD: 4.96Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.75Np Likeness Score: -0.83
References 1. Rodriguez M, Kannangara A, Chlebowicz J, Akella R, He H, Tambar UK, Goldsmith EJ.. (2022) Synthesis and Structural Characterization of Novel Trihalo-sulfone Inhibitors of WNK1., 13 (10.0): [PMID:36262391 ] [10.1021/acsmedchemlett.2c00216 ]