The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-Chloro-3-(trifluoromethyl)benzene-1-suffonyl]-L-gamma-glutamyl-L-leucyl-L-leucyl-L-methioninamide ID: ALA5184919
PubChem CID: 168282177
Max Phase: Preclinical
Molecular Formula: C29H43ClF3N5O8S2
Molecular Weight: 746.27
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)CC[C@H](NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)C(=O)O)C(N)=O
Standard InChI: InChI=1S/C29H43ClF3N5O8S2/c1-15(2)12-22(26(41)37-23(13-16(3)4)27(42)36-20(25(34)40)10-11-47-5)35-24(39)9-8-21(28(43)44)38-48(45,46)17-6-7-19(30)18(14-17)29(31,32)33/h6-7,14-16,20-23,38H,8-13H2,1-5H3,(H2,34,40)(H,35,39)(H,36,42)(H,37,41)(H,43,44)/t20-,21-,22-,23-/m0/s1
Standard InChI Key: SGWHMGPSQUGNOO-MLCQCVOFSA-N
Molfile:
RDKit 2D
48 48 0 0 0 0 0 0 0 0999 V2000
-5.7157 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0011 1.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2892 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2892 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9992 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7157 -0.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4303 1.2373 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-6.4303 -0.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4303 -1.2415 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.1449 -0.0037 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.1449 -0.8289 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5746 -0.4125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.8598 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1453 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4307 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1453 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4307 -1.6503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8598 -1.6503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9879 -1.1285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1628 -1.1285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7160 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 0.8251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -1.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 0.8251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0010 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7156 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7156 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 2.0629 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.1449 2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1449 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4303 -1.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 2.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 -1.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 -2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0010 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
1 7 1 0
6 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
4 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 1 1
16 17 2 0
16 18 1 0
12 19 2 0
12 20 2 0
15 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
29 31 1 6
30 32 2 0
30 33 1 0
33 34 1 0
34 35 1 0
34 36 1 1
36 37 1 0
37 38 1 0
38 39 1 0
35 40 1 0
35 41 2 0
25 42 1 1
42 43 1 0
43 44 1 0
43 45 1 0
31 46 1 0
46 47 1 0
46 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 746.27Molecular Weight (Monoisotopic): 745.2194AlogP: 2.66#Rotatable Bonds: 20Polar Surface Area: 213.86Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.33CX Basic pKa: ┄CX LogP: 2.72CX LogD: -0.70Aromatic Rings: 1Heavy Atoms: 48QED Weighted: 0.12Np Likeness Score: -0.83
References 1. Tabuse H, Abe-Sato K, Kanazawa H, Yashiro M, Tamura Y, Kamitani M, Hitaka K, Gunji E, Mitani A, Kojima N, Oka Y.. (2022) Discovery of Highly Potent and Selective Matrix Metalloproteinase-7 Inhibitors by Hybridizing the S1' Subsite Binder with Short Peptides., 65 (19.0): [PMID:36137271 ] [10.1021/acs.jmedchem.2c01088 ]