4-isopropyl-N-((S)-1-oxo-3-phenyl-1-(((S)-5-phenyl-1-(phenylsulfonyl)pent-1-en-3-yl)amino)propan-2-yl)piperazine-1-carboxamide

ID: ALA5185113

PubChem CID: 168282190

Max Phase: Preclinical

Molecular Formula: C34H42N4O4S

Molecular Weight: 602.80

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)N1CCN(C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](/C=C/S(=O)(=O)c2ccccc2)CCc2ccccc2)CC1

Standard InChI:  InChI=1S/C34H42N4O4S/c1-27(2)37-21-23-38(24-22-37)34(40)36-32(26-29-14-8-4-9-15-29)33(39)35-30(19-18-28-12-6-3-7-13-28)20-25-43(41,42)31-16-10-5-11-17-31/h3-17,20,25,27,30,32H,18-19,21-24,26H2,1-2H3,(H,35,39)(H,36,40)/b25-20+/t30-,32-/m0/s1

Standard InChI Key:  WBKKSIZQDJZMID-DPTAGMOHSA-N

Molfile:  

 
     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
    0.7145   -0.8245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290    0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0001   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0001    0.4132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1436    0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1436   -0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5729   -0.8246    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.2876   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2878    0.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0007    0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7154    0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7172   -0.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0053   -0.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1596   -1.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9847   -1.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293   -0.4118    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440   -0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8586   -0.4118    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440   -1.6496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5733   -0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2878   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2878    0.4132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5733    0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8586    0.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0025    0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0001   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147   -1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4268   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4268   -2.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7165   -3.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0001   -2.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1436    1.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8613    2.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8565    2.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1446    3.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4290    2.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4298    2.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7172    0.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0025    1.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  1
  1  4  1  0
  4  5  1  0
  4  6  2  0
  3  7  1  0
  2  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 10 17  2  0
 10 18  2  0
  5 19  1  6
  5 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 24 22  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 22 28  1  0
 26 29  1  0
 19 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 30 35  1  0
  7 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 40 36  2  0
 41 40  1  0
 39 41  2  0
 29 42  1  0
 29 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5185113

    ---

Associated Targets(non-human)

SARS-CoV (424 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ebolavirus (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 602.80Molecular Weight (Monoisotopic): 602.2927AlogP: 4.44#Rotatable Bonds: 12
Polar Surface Area: 98.82Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.94CX Basic pKa: 7.57CX LogP: 4.74CX LogD: 4.34
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.32Np Likeness Score: -0.61

References

1. Ahmadi R, Emami S..  (2022)  Recent applications of vinyl sulfone motif in drug design and discovery.,  234  [PMID:35305462] [10.1016/j.ejmech.2022.114255]

Source