(S)-((2R,3R,4R,5S,6R)-3-butyramido-4,5-dihydroxy-6-(hydroxymethyl)-tetrahydro-2H-pyran-2-yl) 2-((Z)-hexadec-8-enamido)-3-methylbutanoate

ID: ALA518533

PubChem CID: 44567593

Max Phase: Preclinical

Molecular Formula: C31H56N2O8

Molecular Weight: 584.80

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCCCCC/C=C\CCCCCCC(=O)N[C@H](C(=O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)CCC)C(C)C

Standard InChI:  InChI=1S/C31H56N2O8/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-20-25(36)32-26(22(3)4)30(39)41-31-27(33-24(35)19-6-2)29(38)28(37)23(21-34)40-31/h12-13,22-23,26-29,31,34,37-38H,5-11,14-21H2,1-4H3,(H,32,36)(H,33,35)/b13-12-/t23-,26+,27-,28-,29-,31-/m1/s1

Standard InChI Key:  TWCJCOZMQBRJOA-YYTWYAIJSA-N

Molfile:  

     RDKit          2D

 41 41  0  0  0  0  0  0  0  0999 V2000
   10.3488   -3.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3488   -4.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0647   -5.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7831   -4.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7831   -3.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0647   -3.3880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6403   -3.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6390   -2.5726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6388   -5.0477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0629   -5.8727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4997   -3.3961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2150   -3.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9273   -3.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2136   -4.6346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6423   -3.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6412   -4.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9284   -2.5732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4981   -5.0492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4965   -5.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2115   -6.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7798   -6.2850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9281   -5.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6388   -6.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6449   -2.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6421   -1.3369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3560   -2.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3547   -3.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0725   -2.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7877   -2.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5040   -2.1621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2150   -2.5757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9315   -2.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6343   -2.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6421   -3.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9322   -3.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9400   -4.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2300   -5.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2378   -5.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5278   -6.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5358   -7.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8258   -7.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 19 20  1  0
  3 10  1  1
 19 21  2  0
  3  4  1  0
 20 22  1  0
  5 11  1  6
 22 23  1  0
  4  5  1  0
 17 24  1  0
 11 12  1  0
 24 25  2  0
  5  6  1  0
 24 26  1  0
 12 13  1  0
 26 28  1  0
 12 14  2  0
 28 29  1  0
  1  7  1  1
 29 30  1  0
 13 15  1  0
 30 31  1  0
 15 27  1  0
 31 32  1  0
  1  2  1  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
  7  8  1  0
 34 35  1  0
 13 17  1  1
 35 36  1  0
  1  6  1  0
 36 37  1  0
  4 18  1  6
 37 38  1  0
  2  9  1  6
 38 39  1  0
 18 19  1  0
 39 40  1  0
  2  3  1  0
 40 41  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA518533

   [(2R,3R,4R,5S,6R)-3-(butanoylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] (2S)-2-[[(Z)-hexadec-8-enoyl]amino]-3-methylbutanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 584.80

Molecular Weight (Monoisotopic): 584.4037

AlogP: 3.65

#Rotatable Bonds: 21

Polar Surface Area: 154.42

Molecular Species: NEUTRAL

HBA: 8

HBD: 5

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 5

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 12.04

CX Basic pKa: ┄

CX LogP: 4.83

CX LogD: 4.83

Aromatic Rings: ┄

Heavy Atoms: 41

QED Weighted: 0.08

Np Likeness Score: 0.81

References

1. Dwivedi D, Jansen R, Molinari G, Nimtz M, Johri BN, Wray V..  (2008)  Antimycobacterial serratamolides and diacyl peptoglucosamine derivatives from Serratia sp.,  71  (4): [PMID:18303848] [10.1021/np7007126]

Source

Source(1):

• Scientific Literature