(S)-((2R,3R,4R,5S,6R)-3-butyramido-4,5-dihydroxy-6-(hydroxymethyl)-tetrahydro-2H-pyran-2-yl) 2-((Z)-hexadec-8-enamido)-3-methylbutanoate

ID: ALA518533

PubChem CID: 44567593

Max Phase: Preclinical

Molecular Formula: C31H56N2O8

Molecular Weight: 584.80

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCC/C=C\CCCCCCC(=O)N[C@H](C(=O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)CCC)C(C)C

Standard InChI:  InChI=1S/C31H56N2O8/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-20-25(36)32-26(22(3)4)30(39)41-31-27(33-24(35)19-6-2)29(38)28(37)23(21-34)40-31/h12-13,22-23,26-29,31,34,37-38H,5-11,14-21H2,1-4H3,(H,32,36)(H,33,35)/b13-12-/t23-,26+,27-,28-,29-,31-/m1/s1

Standard InChI Key:  TWCJCOZMQBRJOA-YYTWYAIJSA-N

Molfile:  

     RDKit          2D

 41 41  0  0  0  0  0  0  0  0999 V2000
   10.3488   -3.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3488   -4.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0647   -5.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7831   -4.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7831   -3.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0647   -3.3880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6403   -3.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6390   -2.5726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6388   -5.0477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0629   -5.8727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4997   -3.3961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2150   -3.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9273   -3.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2136   -4.6346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6423   -3.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6412   -4.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9284   -2.5732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4981   -5.0492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4965   -5.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2115   -6.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7798   -6.2850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9281   -5.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6388   -6.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6449   -2.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6421   -1.3369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3560   -2.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3547   -3.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0725   -2.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7877   -2.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5040   -2.1621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2150   -2.5757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9315   -2.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6343   -2.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6421   -3.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9322   -3.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9400   -4.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2300   -5.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2378   -5.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5278   -6.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5358   -7.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8258   -7.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 19 20  1  0
  3 10  1  1
 19 21  2  0
  3  4  1  0
 20 22  1  0
  5 11  1  6
 22 23  1  0
  4  5  1  0
 17 24  1  0
 11 12  1  0
 24 25  2  0
  5  6  1  0
 24 26  1  0
 12 13  1  0
 26 28  1  0
 12 14  2  0
 28 29  1  0
  1  7  1  1
 29 30  1  0
 13 15  1  0
 30 31  1  0
 15 27  1  0
 31 32  1  0
  1  2  1  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
  7  8  1  0
 34 35  1  0
 13 17  1  1
 35 36  1  0
  1  6  1  0
 36 37  1  0
  4 18  1  6
 37 38  1  0
  2  9  1  6
 38 39  1  0
 18 19  1  0
 39 40  1  0
  2  3  1  0
 40 41  1  0
M  END

Associated Targets(non-human)

Mycolicibacterium diernhoferi (48 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycolicibacterium phlei (631 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycolicibacterium smegmatis (8003 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 584.80Molecular Weight (Monoisotopic): 584.4037AlogP: 3.65#Rotatable Bonds: 21
Polar Surface Area: 154.42Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.04CX Basic pKa: CX LogP: 4.83CX LogD: 4.83
Aromatic Rings: Heavy Atoms: 41QED Weighted: 0.08Np Likeness Score: 0.81

References

1. Dwivedi D, Jansen R, Molinari G, Nimtz M, Johri BN, Wray V..  (2008)  Antimycobacterial serratamolides and diacyl peptoglucosamine derivatives from Serratia sp.,  71  (4): [PMID:18303848] [10.1021/np7007126]

Source