2-((6S)-9-bromo-6-ethyl-2,3-dioxo-1,2,3,5,6,7-hexahydropyrido[1,2,3-de]quinoxalin-5-yl)acetic acid

ID: ALA5185347

PubChem CID: 168278856

Max Phase: Preclinical

Molecular Formula: C15H15BrN2O4

Molecular Weight: 367.20

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@H]1Cc2cc(Br)cc3[nH]c(=O)c(=O)n(c23)C1CC(=O)O

Standard InChI:  InChI=1S/C15H15BrN2O4/c1-2-7-3-8-4-9(16)5-10-13(8)18(11(7)6-12(19)20)15(22)14(21)17-10/h4-5,7,11H,2-3,6H2,1H3,(H,17,21)(H,19,20)/t7-,11?/m0/s1

Standard InChI Key:  VAKWFAARKWMFQB-RGENBBCFSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   -1.4279   -0.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7133   -0.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -0.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -1.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7115   -2.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4279   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -0.4082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4278   -0.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4278   -1.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7131   -2.0587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7124    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1425   -2.0623    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.1425   -2.0587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1425   -0.4082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4266    0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4266    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413    2.0623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    2.0623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    1.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7144    2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  2 11  1  0
 12 11  1  0
 13 12  1  0
  7 13  1  0
  6 14  1  0
  9 15  2  0
  8 16  2  0
 13 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 12 21  1  6
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5185347

    ---

Associated Targets(Human)

GRIN1 Tclin Glutamate [NMDA] receptor (933 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 367.20Molecular Weight (Monoisotopic): 366.0215AlogP: 2.05#Rotatable Bonds: 3
Polar Surface Area: 92.16Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.34CX Basic pKa: CX LogP: 2.33CX LogD: -1.08
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.81Np Likeness Score: 0.24

References

1. Jiang X, Wu K, Bai R, Zhang P, Zhang Y..  (2022)  Functionalized quinoxalinones as privileged structures with broad-ranging pharmacological activities.,  229  [PMID:34998058] [10.1016/j.ejmech.2021.114085]

Source