The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((1-isobutyl-5-nitro-1H-indol-3-yl)methyl)-2-methoxy-N-(4-nitrophenylsulfonyl)benzamide ID: ALA5185645
PubChem CID: 168284254
Max Phase: Preclinical
Molecular Formula: C27H26N4O8S
Molecular Weight: 566.59
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2cn(CC(C)C)c3ccc([N+](=O)[O-])cc23)cc1C(=O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C27H26N4O8S/c1-17(2)15-29-16-19(23-14-21(31(35)36)7-10-25(23)29)12-18-4-11-26(39-3)24(13-18)27(32)28-40(37,38)22-8-5-20(6-9-22)30(33)34/h4-11,13-14,16-17H,12,15H2,1-3H3,(H,28,32)
Standard InChI Key: FZSZUGQRCQCCFY-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
-3.8977 -1.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1832 -1.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4713 -1.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4713 -2.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1813 -2.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8977 -2.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6866 -2.5024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2015 -1.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6865 -1.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4729 -0.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6758 -0.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4620 0.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3328 0.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9164 0.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7054 -0.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0898 -0.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7135 0.4825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2970 -0.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5463 1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0371 2.2331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3434 1.8632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5569 2.6603 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.3540 2.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5679 3.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3627 3.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9464 3.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7354 2.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9400 2.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7435 3.5130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3270 2.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9570 4.3101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5569 3.4871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8423 3.0729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6124 -1.0100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6124 -0.1848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3270 -1.4226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4730 -3.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6759 -3.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 -4.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0924 -2.9295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
8 7 1 0
9 8 2 0
3 9 1 0
9 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
14 17 1 0
17 18 1 0
13 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
29 26 1 0
29 30 1 0
29 31 2 0
22 32 2 0
22 33 2 0
34 1 1 0
34 35 1 0
34 36 2 0
7 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
M CHG 4 29 1 30 -1 34 1 35 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.59Molecular Weight (Monoisotopic): 566.1471AlogP: 4.83#Rotatable Bonds: 10Polar Surface Area: 163.68Molecular Species: ACIDHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.18CX Basic pKa: ┄CX LogP: 5.80CX LogD: 4.86Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.14
References 1. Howard KC, Garneau-Tsodikova S.. (2022) Selective Inhibition of the Periodontal Pathogen Porphyromonas gingivalis by Third-Generation Zafirlukast Derivatives., 65 (21.0): [PMID:36273428 ] [10.1021/acs.jmedchem.2c01471 ]