Sodium 4-((1-(1-(4-(3,4-dihydroisoquinolin-2(1H)-yl)-4-oxobutyl)-1H-tetrazol-5-yl)ethyl)amino)-3-hydroxybutanoate

ID: ALA5185958

PubChem CID: 168281431

Max Phase: Preclinical

Molecular Formula: C20H27N6NaO4

Molecular Weight: 416.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(NCC(O)CC(=O)[O-])c1nnnn1CCCC(=O)N1CCc2ccccc2C1.[Na+]

Standard InChI:  InChI=1S/C20H28N6O4.Na/c1-14(21-12-17(27)11-19(29)30)20-22-23-24-26(20)9-4-7-18(28)25-10-8-15-5-2-3-6-16(15)13-25;/h2-3,5-6,14,17,21,27H,4,7-13H2,1H3,(H,29,30);/q;+1/p-1

Standard InChI Key:  HZWUDBJRADGARN-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   -4.2785   -0.8228    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
    0.8200    2.4589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1526    2.9439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4074    3.7286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2325    3.7286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4874    2.9439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6444    2.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8200    1.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5346    1.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5346    0.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2493   -0.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2493   -0.8416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9639    0.3960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9639   -1.2541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9639   -2.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2492   -2.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5346   -2.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5346   -1.2541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6760   -2.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6762   -3.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9661   -3.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2495   -3.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8580    1.9332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6550    1.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8686    0.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6657    0.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2851    0.3391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8792   -0.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6762   -0.3014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2957   -0.6714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2279    3.3138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  2  1  0
  3  7  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  1  0
 12 18  1  0
 15 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 16 22  1  0
  7 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  2  0
  7 31  1  0
M  CHG  2   1   1  29  -1
M  END

Associated Targets(Human)

CASP1 Tchem Caspase-1 (6235 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.48Molecular Weight (Monoisotopic): 416.2172AlogP: 0.52#Rotatable Bonds: 10
Polar Surface Area: 133.47Molecular Species: ACIDHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.47CX Basic pKa: 7.41CX LogP: -2.42CX LogD: -2.67
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -1.42

References

1. Ulgheri F, Spanu P, Deligia F, Loriga G, Fuggetta MP, de Haan I, Chandgudge A, Groves M, Domling A..  (2022)  Design, synthesis and biological evaluation of 1,5-disubstituted α-amino tetrazole derivatives as non-covalent inflammasome-caspase-1 complex inhibitors with potential application against immune and inflammatory disorders.,  229  [PMID:34823899] [10.1016/j.ejmech.2021.114002]

Source