The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl ((E)-3-(4-chlorophenyl)acryloyl)glycyl-L-valyl-D-glutamate ID: ALA5186060
PubChem CID: 168280253
Max Phase: Preclinical
Molecular Formula: C25H34ClN3O7
Molecular Weight: 524.01
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1ccc(Cl)cc1)C(C)C)C(=O)OCC
Standard InChI: InChI=1S/C25H34ClN3O7/c1-5-35-22(32)14-12-19(25(34)36-6-2)28-24(33)23(16(3)4)29-21(31)15-27-20(30)13-9-17-7-10-18(26)11-8-17/h7-11,13,16,19,23H,5-6,12,14-15H2,1-4H3,(H,27,30)(H,28,33)(H,29,31)/b13-9+/t19-,23+/m1/s1
Standard InChI Key: OIJVUEZFBMGOKD-WKZIBFJNSA-N
Molfile:
RDKit 2D
36 36 0 0 0 0 0 0 0 0999 V2000
-2.8792 0.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1648 0.8614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8792 -0.3764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5939 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3087 0.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0234 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7382 0.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4504 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4504 1.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7400 2.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0234 1.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1651 2.0992 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.4500 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7353 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0207 0.4487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7353 1.6866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6940 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4087 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6940 1.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1233 0.8614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4087 -0.3765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8381 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5528 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2674 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9822 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6969 0.4487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4115 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8381 -0.3765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5528 -0.7891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1233 -0.7891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5528 -1.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8854 -2.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1651 0.5258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9822 1.6866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4087 2.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0207 2.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
4 5 2 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
9 12 1 0
2 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
17 19 1 1
18 20 1 0
18 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
22 28 1 6
28 29 1 0
28 30 2 0
29 31 1 0
32 31 1 0
33 27 1 0
25 34 2 0
35 19 1 0
19 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.01Molecular Weight (Monoisotopic): 523.2085AlogP: 2.00#Rotatable Bonds: 14Polar Surface Area: 139.90Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.95CX Basic pKa: ┄CX LogP: 2.10CX LogD: 2.10Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -0.47