The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,7aR,11aR)-3-isopropyl-9-(4-(trifluoromethoxy)benzyl)octahydrooxazolo[2,3-j][1,6]naphthyridin-5(6H)-one ID: ALA5186518
PubChem CID: 168279913
Max Phase: Preclinical
Molecular Formula: C21H27F3N2O3
Molecular Weight: 412.45
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H]1CO[C@]23CCN(Cc4ccc(OC(F)(F)F)cc4)C[C@H]2CCC(=O)N13
Standard InChI: InChI=1S/C21H27F3N2O3/c1-14(2)18-13-28-20-9-10-25(12-16(20)5-8-19(27)26(18)20)11-15-3-6-17(7-4-15)29-21(22,23)24/h3-4,6-7,14,16,18H,5,8-13H2,1-2H3/t16-,18-,20-/m1/s1
Standard InChI Key: NELFXUPMACHOGC-YVWKXTFCSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-1.9587 0.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2443 0.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5297 0.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5297 -0.4053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2443 -0.8178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9587 -0.4053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2443 -1.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5300 -2.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1843 -1.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8960 -2.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8960 -2.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1861 -3.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5300 -2.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6103 -3.2919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3246 -2.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1847 0.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1847 1.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5297 2.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2442 1.6571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0288 1.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5137 1.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0288 0.5773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2422 2.7087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0388 2.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6590 3.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5297 2.8944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1844 0.0072 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.0388 -3.2919 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.7378 -2.1640 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9130 -2.1640 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
11 14 1 0
14 15 1 0
3 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
2 19 1 6
19 20 1 0
21 20 1 0
22 21 1 0
2 22 1 0
20 23 1 6
23 24 1 0
23 25 1 0
18 26 2 0
3 27 1 1
15 28 1 0
15 29 1 0
15 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.45Molecular Weight (Monoisotopic): 412.1974AlogP: 3.78#Rotatable Bonds: 4Polar Surface Area: 42.01Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.41CX LogP: 4.77CX LogD: 3.73Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -0.37
References 1. Dam S, Tangara S, Hamela C, Hattabi T, Faïon L, Carre P, Antoine R, Herledan A, Leroux F, Piveteau C, Eveque M, Flipo M, Deprez B, Kremer L, Willand N, Villemagne B, Hartkoorn RC.. (2022) Tricyclic SpiroLactams Kill Mycobacteria In Vitro and In Vivo by Inhibiting Type II NADH Dehydrogenases., 65 (24.0): [PMID:36473699 ] [10.1021/acs.jmedchem.2c01493 ]