5-chloro-2-(3,5-dimethylphenyl)-2,3-dihydroquinazolin-4(1H)-one

ID: ALA5186537

PubChem CID: 164880777

Max Phase: Preclinical

Molecular Formula: C16H15ClN2O

Molecular Weight: 286.76

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)cc(C2NC(=O)c3c(Cl)cccc3N2)c1

Standard InChI:  InChI=1S/C16H15ClN2O/c1-9-6-10(2)8-11(7-9)15-18-13-5-3-4-12(17)14(13)16(20)19-15/h3-8,15,18H,1-2H3,(H,19,20)

Standard InChI Key:  CIMCDERYWHODGC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   -2.8577    0.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1408   -0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4303    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7153   -0.2068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002    1.0316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7153    1.4445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4303    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1427    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8577    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7153    2.2702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7148   -0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7148   -1.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4319   -1.4445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426   -0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4301    0.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1427    2.2695    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.8577    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4319   -2.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  7  1  0
  3  8  2  0
  8  9  1  0
  9 10  2  0
 10  1  1  0
  7 11  2  0
  5 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
  9 18  1  0
 16 19  1  0
 14 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5186537

    ---

Associated Targets(Human)

PBRM1 Tchem Protein polybromo-1 (712 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 286.76Molecular Weight (Monoisotopic): 286.0873AlogP: 3.81#Rotatable Bonds: 1
Polar Surface Area: 41.13Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.50CX Basic pKa: CX LogP: 4.68CX LogD: 4.68
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.84Np Likeness Score: -0.77

References

1. Shishodia S, Nuñez R, Strohmier BP, Bursch KL, Goetz CJ, Olp MD, Jensen DR, Fenske TG, Ordonez-Rubiano SC, Blau ME, Roach MK, Peterson FC, Volkman BF, Dykhuizen EC, Smith BC..  (2022)  Selective and Cell-Active PBRM1 Bromodomain Inhibitors Discovered through NMR Fragment Screening.,  65  (20.0): [PMID:36227159] [10.1021/acs.jmedchem.2c00864]

Source