The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Bicuculline ID: ALA5186559
PubChem CID: 168283089
Max Phase: Preclinical
Molecular Formula: C20H21NO5
Molecular Weight: 355.39
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCc2cc3c(cc2[C@H]1[C@@H]1OCC2=C1C=CC1OCOC21)OCO3
Standard InChI: InChI=1S/C20H21NO5/c1-21-5-4-11-6-16-17(25-9-24-16)7-13(11)18(21)20-12-2-3-15-19(26-10-23-15)14(12)8-22-20/h2-3,6-7,15,18-20H,4-5,8-10H2,1H3/t15?,18-,19?,20+/m0/s1
Standard InChI Key: IKVQQXGYHLZXPD-FOCMDNRUSA-N
Molfile:
RDKit 2D
28 33 0 0 0 0 0 0 0 0999 V2000
1.9728 -29.2538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3855 -27.9909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7226 -28.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0526 -28.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7923 -29.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3383 -29.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8504 -28.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3939 -28.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1399 -29.6951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6870 -30.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4910 -30.1341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7451 -29.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1951 -28.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4278 -31.0808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4283 -32.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9147 -31.7493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6477 -32.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6523 -31.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9534 -30.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2414 -31.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9442 -32.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2388 -32.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6297 -32.6960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9571 -33.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7685 -33.3606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0359 -30.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2127 -31.2885 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.8672 -30.2939 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
4 2 1 0
2 3 1 0
3 1 1 0
4 5 1 0
5 6 2 0
6 9 1 0
8 7 1 0
7 4 2 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
10 14 1 0
14 18 1 0
17 15 1 0
15 16 1 0
16 14 1 0
17 18 2 0
17 21 1 0
18 19 1 0
19 20 2 0
20 22 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 21 1 0
11 26 1 0
14 27 1 1
10 28 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 355.39Molecular Weight (Monoisotopic): 355.1420AlogP: 1.95#Rotatable Bonds: 1Polar Surface Area: 49.39Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.60CX LogP: 1.63CX LogD: 1.22Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.77Np Likeness Score: 1.56
References 1. Bavo F, de-Jong H, Petersen J, Falk-Petersen CB, Löffler R, Sparrow E, Rostrup F, Eliasen JN, Wilhelmsen KS, Barslund K, Bundgaard C, Nielsen B, Kristiansen U, Wellendorph P, Bogdanov Y, Frølund B.. (2021) Structure-Activity Studies of 3,9-Diazaspiro[5.5]undecane-Based γ-Aminobutyric Acid Type A Receptor Antagonists with Immunomodulatory Effect., 64 (24.0): [PMID:34908407 ] [10.1021/acs.jmedchem.1c00290 ]