The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-dimethoxyphenyl)-3,7-dimethoxy-5-(4-(4-methylpiperazin-1-yl)butoxy)-4H-chromen-4-one ID: ALA5186872
PubChem CID: 168280725
Max Phase: Preclinical
Molecular Formula: C28H36N2O7
Molecular Weight: 512.60
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OCCCCN2CCN(C)CC2)c2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1
Standard InChI: InChI=1S/C28H36N2O7/c1-29-11-13-30(14-12-29)10-6-7-15-36-23-17-20(32-2)18-24-25(23)26(31)28(35-5)27(37-24)19-8-9-21(33-3)22(16-19)34-4/h8-9,16-18H,6-7,10-15H2,1-5H3
Standard InChI Key: DOQHSNXMXFVVFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-2.8576 2.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1431 2.6814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4286 2.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4286 1.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7123 1.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7123 0.2076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4269 -0.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4269 -1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1414 -1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1414 -2.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8559 -2.6800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8559 -3.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5704 -3.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2849 -3.5050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2849 -2.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5704 -2.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9993 -3.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0023 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7120 1.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7120 0.2068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4266 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1410 1.0318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8556 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4266 2.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1410 2.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8586 2.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5704 2.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2849 2.2715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9993 2.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5704 3.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2833 3.9175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9978 3.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8540 3.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1410 3.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7120 2.6818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0023 2.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
11 16 1 0
14 17 1 0
5 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
21 24 2 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 1 0
31 32 1 0
30 33 2 0
33 34 1 0
34 25 2 0
24 35 1 0
36 35 1 0
18 36 2 0
36 37 1 0
37 3 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.60Molecular Weight (Monoisotopic): 512.2523AlogP: 3.90#Rotatable Bonds: 11Polar Surface Area: 82.84Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.01CX LogP: 2.65CX LogD: 1.94Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: 0.08
References 1. Rangel VM, Gu L, Chen G, Chen QH, Xue L.. (2022) 5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands., 61 [PMID:35143982 ] [10.1016/j.bmcl.2022.128608 ]