2-(3,4-dimethoxyphenyl)-3,7-dimethoxy-5-(4-(4-methylpiperazin-1-yl)butoxy)-4H-chromen-4-one

ID: ALA5186872

PubChem CID: 168280725

Max Phase: Preclinical

Molecular Formula: C28H36N2O7

Molecular Weight: 512.60

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(OCCCCN2CCN(C)CC2)c2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1

Standard InChI:  InChI=1S/C28H36N2O7/c1-29-11-13-30(14-12-29)10-6-7-15-36-23-17-20(32-2)18-24-25(23)26(31)28(35-5)27(37-24)19-8-9-21(33-3)22(16-19)34-4/h8-9,16-18H,6-7,10-15H2,1-5H3

Standard InChI Key:  DOQHSNXMXFVVFC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -2.8576    2.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1431    2.6814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286    2.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286    1.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123    1.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123    0.2076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4269   -0.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4269   -1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1414   -1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1414   -2.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8559   -2.6800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8559   -3.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5704   -3.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2849   -3.5050    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2849   -2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5704   -2.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9993   -3.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0023    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    0.2068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4266    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1410    1.0318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8556    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4266    2.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1410    2.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8586    2.2676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5704    2.6840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2849    2.2715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9993    2.6840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5704    3.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2833    3.9175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9978    3.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8540    3.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1410    3.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    2.6818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0023    2.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7141    2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 11 16  1  0
 14 17  1  0
  5 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 30 33  2  0
 33 34  1  0
 34 25  2  0
 24 35  1  0
 36 35  1  0
 18 36  2  0
 36 37  1  0
 37  3  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5186872

    ---

Associated Targets(Human)

dsDNA (365 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.60Molecular Weight (Monoisotopic): 512.2523AlogP: 3.90#Rotatable Bonds: 11
Polar Surface Area: 82.84Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.01CX LogP: 2.65CX LogD: 1.94
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: 0.08

References

1. Rangel VM, Gu L, Chen G, Chen QH, Xue L..  (2022)  5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands.,  61  [PMID:35143982] [10.1016/j.bmcl.2022.128608]

Source