5,8-dimethoxy-6-(((7-methylbenzo[d]thiazol-2-yl)amino)methyl)naphthalene-1,4-dione

ID: ALA5187114

PubChem CID: 168278648

Max Phase: Preclinical

Molecular Formula: C21H18N2O4S

Molecular Weight: 394.45

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(CNc2nc3cccc(C)c3s2)c(OC)c2c1C(=O)C=CC2=O

Standard InChI:  InChI=1S/C21H18N2O4S/c1-11-5-4-6-13-20(11)28-21(23-13)22-10-12-9-16(26-2)17-14(24)7-8-15(25)18(17)19(12)27-3/h4-9H,10H2,1-3H3,(H,22,23)

Standard InChI Key:  UALAZJBZOTVTDU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -3.7699    0.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0554    1.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3409    0.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3409   -0.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0554   -0.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7699   -0.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6283    1.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9136    0.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9118   -0.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6233   -0.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0554    1.8847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0554   -1.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6283    1.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3426    2.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6233   -1.4162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9091   -1.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1975   -0.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5166   -0.1749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2309   -0.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9840   -0.2520    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5356   -0.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1234   -1.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3170   -1.4071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3574   -0.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7699   -1.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3614   -2.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5375   -2.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7698   -0.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  2  0
  6  5  1  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
  2 11  2  0
  5 12  2  0
  7 13  1  0
 13 14  1  0
 10 15  1  0
 15 16  1  0
  9 17  1  0
 17 18  1  0
 18 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  2  0
 21 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 24 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5187114

    ---

Associated Targets(Human)

SNU1 (253 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Sarcoma-180 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.45Molecular Weight (Monoisotopic): 394.0987AlogP: 4.17#Rotatable Bonds: 5
Polar Surface Area: 77.52Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.89CX LogP: 3.71CX LogD: 3.71
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.70Np Likeness Score: -0.52

References

1. Valipour M..  (2022)  Recent advances of antitumor shikonin/alkannin derivatives: A comprehensive overview focusing on structural classification, synthetic approaches, and mechanisms of action.,  235  [PMID:35367708] [10.1016/j.ejmech.2022.114314]

Source