The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sodium 4-((1-(1-(4-(benzylamino)-4-oxobutyl)-1H-tetrazol-5-yl)ethyl)amino)-3-hydroxybutanoate ID: ALA5187240
PubChem CID: 168278215
Max Phase: Preclinical
Molecular Formula: C18H25N6NaO4
Molecular Weight: 390.44
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(NCC(O)CC(=O)[O-])c1nnnn1CCCC(=O)NCc1ccccc1.[Na+]
Standard InChI: InChI=1S/C18H26N6O4.Na/c1-13(19-12-15(25)10-17(27)28)18-21-22-23-24(18)9-5-8-16(26)20-11-14-6-3-2-4-7-14;/h2-4,6-7,13,15,19,25H,5,8-12H2,1H3,(H,20,26)(H,27,28);/q;+1/p-1
Standard InChI Key: MRQXDLPJORVWDL-UHFFFAOYSA-M
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
-4.2071 -0.9871 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
0.8189 2.4583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1515 2.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4064 3.7278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2313 3.7278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4863 2.9432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6455 2.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8589 1.9326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6560 1.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8695 0.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6665 0.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8801 -0.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6771 -0.3019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2966 -0.6717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2861 0.3387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2287 3.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8189 1.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5334 1.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5334 0.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2480 -0.0168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2480 -0.8420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9626 0.3956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9626 -1.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9626 -2.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6771 -2.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6763 -3.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9615 -3.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2496 -3.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2450 -2.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 2 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
10 15 1 0
7 16 1 0
2 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
M CHG 2 1 1 13 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.44Molecular Weight (Monoisotopic): 390.2016AlogP: 0.26#Rotatable Bonds: 12Polar Surface Area: 142.26Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.77CX Basic pKa: 7.41CX LogP: -2.69CX LogD: -2.93Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.40Np Likeness Score: -1.35
References 1. Ulgheri F, Spanu P, Deligia F, Loriga G, Fuggetta MP, de Haan I, Chandgudge A, Groves M, Domling A.. (2022) Design, synthesis and biological evaluation of 1,5-disubstituted α-amino tetrazole derivatives as non-covalent inflammasome-caspase-1 complex inhibitors with potential application against immune and inflammatory disorders., 229 [PMID:34823899 ] [10.1016/j.ejmech.2021.114002 ]