The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-5-Amino-1-(((S)-1-(3-amino-N-(2-amino-2-oxoethyl)propanamido)-3-phenylpropan-2-yl)amino)-1-oxopentan-2-yl)palmitamide ID: ALA5187361
PubChem CID: 164946828
Max Phase: Preclinical
Molecular Formula: C35H62N6O4
Molecular Weight: 630.92
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCC(=O)N[C@@H](CCCN)C(=O)N[C@@H](Cc1ccccc1)CN(CC(N)=O)C(=O)CCN
Standard InChI: InChI=1S/C35H62N6O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-22-33(43)40-31(21-18-24-36)35(45)39-30(26-29-19-15-14-16-20-29)27-41(28-32(38)42)34(44)23-25-37/h14-16,19-20,30-31H,2-13,17-18,21-28,36-37H2,1H3,(H2,38,42)(H,39,45)(H,40,43)/t30-,31-/m0/s1
Standard InChI Key: ZNTVQLYTHZKKRD-CONSDPRKSA-N
Molfile:
RDKit 2D
45 45 0 0 0 0 0 0 0 0999 V2000
4.6459 -1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3602 -0.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0751 -1.0308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3602 0.2071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9311 -0.6180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2162 -1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9311 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2162 -1.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5017 -0.6180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9311 -2.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9311 -3.0939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2162 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2162 1.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9311 1.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5017 0.2072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7869 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0722 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9313 2.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6443 3.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3592 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3608 1.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6489 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7869 1.4451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3574 0.6199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0719 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -0.6180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0722 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7869 -1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7869 -1.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5017 -2.2686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7867 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2161 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9309 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6456 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3602 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0751 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0751 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3602 -1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6456 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9309 -1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2161 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 -1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7867 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
5 6 1 0
5 7 1 0
6 8 1 0
6 9 2 0
8 10 1 0
10 11 1 0
7 12 1 0
12 13 1 1
13 14 1 0
12 15 1 0
15 16 1 0
16 17 1 0
18 14 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
14 22 1 0
16 23 2 0
17 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
17 28 1 6
28 29 1 0
29 30 1 0
30 31 1 0
26 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 630.92Molecular Weight (Monoisotopic): 630.4833AlogP: 4.08#Rotatable Bonds: 28Polar Surface Area: 173.64Molecular Species: BASEHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.96CX Basic pKa: 9.73CX LogP: 3.86CX LogD: 0.01Aromatic Rings: 1Heavy Atoms: 45QED Weighted: 0.09Np Likeness Score: -0.25
References 1. Zhang X, Wang M, Zhu X, Peng Y, Fu T, Hu CH, Cai J, Liao G.. (2022) Development of Lipo-γ-AA Peptides as Potent Antifungal Agents., 65 (11.0): [PMID:35637173 ] [10.1021/acs.jmedchem.2c00595 ]