The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-chloro-4-fluorophenyl)-1-(4-fluorophenyl)-3-methyl-1H-pyrazolo[4,3-d]pyrimidin-7-amine ID: ALA5187375
PubChem CID: 168279644
Max Phase: Preclinical
Molecular Formula: C18H12ClF2N5
Molecular Weight: 371.78
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(-c2ccc(F)cc2)c2c(Nc3ccc(F)c(Cl)c3)ncnc12
Standard InChI: InChI=1S/C18H12ClF2N5/c1-10-16-17(26(25-10)13-5-2-11(20)3-6-13)18(23-9-22-16)24-12-4-7-15(21)14(19)8-12/h2-9H,1H3,(H,22,23,24)
Standard InChI Key: LBSCIFOFCMWXSU-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
-0.6457 1.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0688 2.1562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7807 1.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7807 0.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0706 0.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6457 0.9155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5849 1.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0558 1.3408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5637 0.6732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7773 -0.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7985 2.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0706 -0.3178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6440 -0.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6442 -1.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3571 -1.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0719 -1.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0735 -0.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3616 -0.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7866 -1.9663 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.3571 -2.7916 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5744 -0.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7866 -1.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2029 -1.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4093 -1.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1913 -0.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4165 -2.5133 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 2 0
9 8 1 0
4 9 1 0
9 10 1 0
7 11 1 0
5 12 1 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
15 20 1 0
21 10 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
10 25 1 0
23 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 371.78Molecular Weight (Monoisotopic): 371.0749AlogP: 4.80#Rotatable Bonds: 3Polar Surface Area: 55.63Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.61CX LogP: 4.60CX LogD: 4.60Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.56Np Likeness Score: -2.27