(S)-N-(3-(methylamino)-2-(3-methylbenzamido)-3-oxopropyl)-1,4-dioxo-1,2,3,4-tetrahydrophthalazine-6-carboxamide

ID: ALA5187652

PubChem CID: 168279313

Max Phase: Preclinical

Molecular Formula: C21H21N5O5

Molecular Weight: 423.43

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)[C@H](CNC(=O)c1ccc2c(=O)[nH][nH]c(=O)c2c1)NC(=O)c1cccc(C)c1

Standard InChI:  InChI=1S/C21H21N5O5/c1-11-4-3-5-12(8-11)18(28)24-16(21(31)22-2)10-23-17(27)13-6-7-14-15(9-13)20(30)26-25-19(14)29/h3-9,16H,10H2,1-2H3,(H,22,31)(H,23,27)(H,24,28)(H,25,29)(H,26,30)/t16-/m0/s1

Standard InChI Key:  NGCSCKDPDCHBDX-INIZCTEOSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    1.7881    1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5026    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2145    1.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2145    0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5045   -0.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7881    0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292    1.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6438    1.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6438    0.2072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292    2.2700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292   -1.0305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0734   -0.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0734   -1.0342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3588    0.2034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3557   -0.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7850   -0.2090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    1.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7850    1.4413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3557    1.4413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4996    0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2143   -0.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4996    1.0287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2145   -1.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9274   -1.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6422   -1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6438   -0.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9320    0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9274   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3557    2.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  7 11  2  0
 10 12  2  0
  6 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 17 16  1  6
 17 18  1  0
 17 19  1  0
 19 20  2  0
 19 21  1  0
 18 22  1  0
 22 23  1  0
 22 24  2  0
 25 23  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 23 29  1  0
 26 30  1  0
 21 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5187652

    ---

Associated Targets(Human)

PARP15 Tchem Poly [ADP-ribose] polymerase 15 (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 423.43Molecular Weight (Monoisotopic): 423.1543AlogP: -0.20#Rotatable Bonds: 6
Polar Surface Area: 153.02Molecular Species: NEUTRALHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 7.79CX Basic pKa: CX LogP: -0.31CX LogD: -0.44
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -0.83

References

1. Nizi MG, Maksimainen MM, Lehtiö L, Tabarrini O..  (2022)  Medicinal Chemistry Perspective on Targeting Mono-ADP-Ribosylating PARPs with Small Molecules.,  65  (11.0): [PMID:35608571] [10.1021/acs.jmedchem.2c00281]

Source