The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-(methylamino)-2-(3-methylbenzamido)-3-oxopropyl)-1,4-dioxo-1,2,3,4-tetrahydrophthalazine-6-carboxamide ID: ALA5187652
PubChem CID: 168279313
Max Phase: Preclinical
Molecular Formula: C21H21N5O5
Molecular Weight: 423.43
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)[C@H](CNC(=O)c1ccc2c(=O)[nH][nH]c(=O)c2c1)NC(=O)c1cccc(C)c1
Standard InChI: InChI=1S/C21H21N5O5/c1-11-4-3-5-12(8-11)18(28)24-16(21(31)22-2)10-23-17(27)13-6-7-14-15(9-13)20(30)26-25-19(14)29/h3-9,16H,10H2,1-2H3,(H,22,31)(H,23,27)(H,24,28)(H,25,29)(H,26,30)/t16-/m0/s1
Standard InChI Key: NGCSCKDPDCHBDX-INIZCTEOSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
1.7881 1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5026 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2145 1.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2145 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5045 -0.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7881 0.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 1.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6438 1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6438 0.2072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 2.2700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -1.0305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0734 -0.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0734 -1.0342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3588 0.2034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3557 -0.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0704 0.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7850 -0.2090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0704 1.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7850 1.4413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3557 1.4413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4996 0.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2143 -0.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4996 1.0287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2145 -1.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9274 -1.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6422 -1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6438 -0.2111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9320 0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9274 -2.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3557 2.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
4 10 1 0
7 11 2 0
10 12 2 0
6 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
17 16 1 6
17 18 1 0
17 19 1 0
19 20 2 0
19 21 1 0
18 22 1 0
22 23 1 0
22 24 2 0
25 23 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
23 29 1 0
26 30 1 0
21 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.43Molecular Weight (Monoisotopic): 423.1543AlogP: -0.20#Rotatable Bonds: 6Polar Surface Area: 153.02Molecular Species: NEUTRALHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.79CX Basic pKa: ┄CX LogP: -0.31CX LogD: -0.44Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -0.83
References 1. Nizi MG, Maksimainen MM, Lehtiö L, Tabarrini O.. (2022) Medicinal Chemistry Perspective on Targeting Mono-ADP-Ribosylating PARPs with Small Molecules., 65 (11.0): [PMID:35608571 ] [10.1021/acs.jmedchem.2c00281 ]