The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl ((S)-2-(2-((E)-3-(4-hydroxy-3-methoxyphenyl)acrylamido)acetamido)-3-(pyridin-4-yl)propanoyl)-D-glutamate ID: ALA5187696
PubChem CID: 168281103
Max Phase: Preclinical
Molecular Formula: C29H36N4O9
Molecular Weight: 584.63
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CC[C@@H](NC(=O)[C@H](Cc1ccncc1)NC(=O)CNC(=O)/C=C/c1ccc(O)c(OC)c1)C(=O)OCC
Standard InChI: InChI=1S/C29H36N4O9/c1-4-41-27(37)11-8-21(29(39)42-5-2)33-28(38)22(16-20-12-14-30-15-13-20)32-26(36)18-31-25(35)10-7-19-6-9-23(34)24(17-19)40-3/h6-7,9-10,12-15,17,21-22,34H,4-5,8,11,16,18H2,1-3H3,(H,31,35)(H,32,36)(H,33,38)/b10-7+/t21-,22+/m1/s1
Standard InChI Key: ASYPYCRRDPPVRW-ALQXMYAYSA-N
Molfile:
RDKit 2D
42 43 0 0 0 0 0 0 0 0999 V2000
-2.8790 -0.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1646 0.2424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8790 -0.9952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5937 0.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3083 -0.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0230 0.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7378 -0.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4499 0.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4499 1.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7396 1.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0230 1.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1645 1.4801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.1645 -0.1704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.1645 -0.9957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4500 -0.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7353 0.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0206 -0.1701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7353 1.0676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6939 0.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4085 -0.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6939 1.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4085 1.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1232 0.2424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4085 -0.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8378 -0.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5525 0.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2672 -0.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9818 0.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6964 -0.1701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9818 1.0676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4111 0.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8378 -0.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5525 -1.4080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1232 -1.4080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5525 -2.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8852 -2.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1645 -0.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4085 2.3053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1232 2.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8378 2.3053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8378 1.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1232 1.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
4 5 2 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
9 12 1 0
8 13 1 0
13 14 1 0
2 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
19 21 1 1
21 22 1 0
20 23 1 0
20 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
25 32 1 6
32 33 1 0
32 34 2 0
33 35 1 0
36 35 1 0
37 31 1 0
38 22 1 0
39 38 2 0
40 39 1 0
41 40 2 0
42 41 1 0
22 42 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.63Molecular Weight (Monoisotopic): 584.2482AlogP: 1.04#Rotatable Bonds: 16Polar Surface Area: 182.25Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.88CX Basic pKa: 5.05CX LogP: 0.59CX LogD: 0.58Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.16Np Likeness Score: -0.09