(trans)-(S)-4-(4-fluorophenoxy)-N-methyl-N-(2-methyl-4-((3-methylpiperazin-1-yl)methyl)phenyl)cyclohexanecarboxamide

ID: ALA5187776

PubChem CID: 168278248

Max Phase: Preclinical

Molecular Formula: C27H36FN3O2

Molecular Weight: 453.60

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(CN2CCN[C@@H](C)C2)ccc1N(C)C(=O)[C@H]1CC[C@H](Oc2ccc(F)cc2)CC1

Standard InChI:  InChI=1S/C27H36FN3O2/c1-19-16-21(18-31-15-14-29-20(2)17-31)4-13-26(19)30(3)27(32)22-5-9-24(10-6-22)33-25-11-7-23(28)8-12-25/h4,7-8,11-13,16,20,22,24,29H,5-6,9-10,14-15,17-18H2,1-3H3/t20-,22-,24-/m0/s1

Standard InChI Key:  BXFKSEBZTOEPSP-SSPYTLHUSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -3.5695    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8551    1.8570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1406    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1406    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8551    0.2070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5695    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8551   -0.6177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1408   -1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4262   -0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -1.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -1.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4246   -2.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1408   -1.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4262    1.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -2.2670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138   -1.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -3.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138   -1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4280   -2.2670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4280   -0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138    1.4442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281    1.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282    2.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1408    3.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8552    2.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8567    1.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1454    1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5695    3.0918    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4246   -3.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  5  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
  3 14  1  1
 11 15  1  0
 15 16  1  0
 15 17  1  0
 18 16  1  1
 16 19  2  0
 20 18  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 18 24  1  0
 22 25  1  6
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 29 32  1  0
 12 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5187776

    ---

Associated Targets(Human)

MLNR Tchem Motilin receptor (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYP3A4 Tclin Cytochrome P450 3A4 (53859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.60Molecular Weight (Monoisotopic): 453.2792AlogP: 4.53#Rotatable Bonds: 6
Polar Surface Area: 44.81Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.33CX LogP: 4.61CX LogD: 2.70
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.70Np Likeness Score: -1.22

References

1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M..  (2022)  Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure.,  59  [PMID:35051575] [10.1016/j.bmcl.2022.128554]

Source