The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2-dimethyl-3-[[2-phenyl-5-(p-tolyl)pyrazol-3-yl]amino]-3H-benzo[g]benzofuran-4,5-dione ID: ALA5187816
PubChem CID: 71525253
Max Phase: Preclinical
Molecular Formula: C30H25N3O3
Molecular Weight: 475.55
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2cc(NC3C4=C(OC3(C)C)c3ccccc3C(=O)C4=O)n(-c3ccccc3)n2)cc1
Standard InChI: InChI=1S/C30H25N3O3/c1-18-13-15-19(16-14-18)23-17-24(33(32-23)20-9-5-4-6-10-20)31-29-25-27(35)26(34)21-11-7-8-12-22(21)28(25)36-30(29,2)3/h4-17,29,31H,1-3H3
Standard InChI Key: PHZKISDSHJPMKB-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
-3.6572 2.4425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9426 2.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2306 2.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2306 1.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9407 1.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6572 1.6137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5158 1.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8011 1.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8011 2.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5158 2.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5158 3.6809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0862 2.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3443 0.3979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 1.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5237 0.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5237 -0.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2734 0.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6091 1.2789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1927 0.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0074 0.8244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3820 0.0894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7987 -0.4938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0637 -0.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4202 1.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0123 -1.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0077 2.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4197 2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2453 2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6572 2.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2490 1.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8095 -1.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0218 -2.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4380 -2.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6443 -2.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4262 -1.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6516 -3.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
7 8 2 0
8 9 1 0
3 10 1 0
9 10 1 0
10 11 2 0
9 12 2 0
7 13 1 0
8 14 1 0
14 15 1 0
15 13 1 0
15 16 1 0
15 17 1 0
14 18 1 0
18 19 1 0
20 19 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 2 0
20 24 1 0
22 25 1 0
26 24 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
24 30 1 0
31 25 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
25 35 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.55Molecular Weight (Monoisotopic): 475.1896AlogP: 5.61#Rotatable Bonds: 4Polar Surface Area: 73.22Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.94CX LogP: 5.95CX LogD: 5.95Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -0.33
References 1. Gong Q, Hu J, Wang P, Li X, Zhang X.. (2021) A comprehensive review on β-lapachone: Mechanisms, structural modifications, and therapeutic potentials., 210 [PMID:33158575 ] [10.1016/j.ejmech.2020.112962 ]