The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(trans)-(S)-4-(4-fluorophenoxy)-N-methyl-N-(3-methyl-4-((3-methylpiperazin-1-yl)methyl)phenyl)cyclohexanecarboxamide ID: ALA5187928
PubChem CID: 56960874
Max Phase: Preclinical
Molecular Formula: C27H36FN3O2
Molecular Weight: 453.60
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(N(C)C(=O)[C@H]2CC[C@H](Oc3ccc(F)cc3)CC2)ccc1CN1CCN[C@@H](C)C1
Standard InChI: InChI=1S/C27H36FN3O2/c1-19-16-24(9-4-22(19)18-31-15-14-29-20(2)17-31)30(3)27(32)21-5-10-25(11-6-21)33-26-12-7-23(28)8-13-26/h4,7-9,12-13,16,20-21,25,29H,5-6,10-11,14-15,17-18H2,1-3H3/t20-,21-,25-/m0/s1
Standard InChI Key: GJHNTJDKWVLGHO-WATLYSKOSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.5696 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8552 1.8570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1407 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1407 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8552 0.2069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5696 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8552 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1408 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4262 -0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -1.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4246 -2.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1408 -1.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4262 1.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0004 -2.2672 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7138 -1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0004 -3.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7138 -1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4281 -2.2672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0004 -0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0002 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7138 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4281 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4281 -0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7138 1.4442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4281 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4282 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1408 3.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8554 2.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 1.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1454 1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5696 3.0918 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8552 -2.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
3 14 1 1
11 15 1 0
15 16 1 0
15 17 1 0
18 16 1 1
16 19 2 0
20 18 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 1 0
18 24 1 0
22 25 1 6
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
29 32 1 0
13 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.60Molecular Weight (Monoisotopic): 453.2792AlogP: 4.53#Rotatable Bonds: 6Polar Surface Area: 44.81Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.35CX LogP: 4.61CX LogD: 2.68Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.70Np Likeness Score: -1.22
References 1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M.. (2022) Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure., 59 [PMID:35051575 ] [10.1016/j.bmcl.2022.128554 ]