(trans)-(S)-4-(4-fluorophenoxy)-N-(4-((3-methylpiperazin-1-yl)methyl)phenyl)cyclohexanecarboxamide

ID: ALA5187975

PubChem CID: 168278682

Max Phase: Preclinical

Molecular Formula: C25H32FN3O2

Molecular Weight: 425.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H]1CN(Cc2ccc(NC(=O)[C@H]3CC[C@H](Oc4ccc(F)cc4)CC3)cc2)CCN1

Standard InChI:  InChI=1S/C25H32FN3O2/c1-18-16-29(15-14-27-18)17-19-2-8-22(9-3-19)28-25(30)20-4-10-23(11-5-20)31-24-12-6-21(26)7-13-24/h2-3,6-9,12-13,18,20,23,27H,4-5,10-11,14-17H2,1H3,(H,28,30)/t18-,20-,23-/m0/s1

Standard InChI Key:  PYRSAVVVXYWAJX-LEDOBFOHSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -3.5696    1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8552    1.4446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1407    1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1407    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8552   -0.2054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5696    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8552   -1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1408   -1.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263   -1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -1.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -2.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4246   -2.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1408   -2.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263    1.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -2.6796    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138   -2.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138   -1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281   -2.6796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281   -1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138    1.0318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4281    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4283    2.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1408    2.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8554    2.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8570    1.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1454    1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5696    2.6793    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  5  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
  3 14  1  1
 11 15  1  0
 15 16  1  0
 17 16  1  1
 16 18  2  0
 19 17  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 17 23  1  0
 21 24  1  6
 24 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5187975

    ---

Associated Targets(Human)

MLNR Tchem Motilin receptor (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.55Molecular Weight (Monoisotopic): 425.2479AlogP: 4.20#Rotatable Bonds: 6
Polar Surface Area: 53.60Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.33CX LogP: 4.24CX LogD: 2.32
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.73Np Likeness Score: -1.23

References

1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M..  (2022)  Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure.,  59  [PMID:35051575] [10.1016/j.bmcl.2022.128554]

Source