(2S)-2-amino-6-[[4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-2-oxo-pyrimidin-5-yl]methylamino]hexanoic acid

ID: ALA5188258

PubChem CID: 168279702

Max Phase: Preclinical

Molecular Formula: C16H27N5O6

Molecular Weight: 385.42

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1CNCCCC[C@H](N)C(=O)O

Standard InChI:  InChI=1S/C16H27N5O6/c17-10(15(24)25)3-1-2-4-19-6-9-7-21(16(26)20-14(9)18)13-5-11(23)12(8-22)27-13/h7,10-13,19,22-23H,1-6,8,17H2,(H,24,25)(H2,18,20,26)/t10-,11-,12+,13+/m0/s1

Standard InChI Key:  RIYMDHNAUKQPEJ-WUHRBBMRSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   -2.3006    1.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5861    1.6777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8716    1.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8716    0.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5861    0.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3006    0.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0148    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1010   -0.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9074   -0.9634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3196   -0.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7679    0.3630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1443   -0.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5566   -0.9638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3197   -1.6777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1574    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5568    0.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1574    1.6775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0148    1.6775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2711    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9853    0.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6996    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4139    0.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1281    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8423    0.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1281   -0.7969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8423    1.2649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5566    0.0278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  1  0
  7  6  1  1
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 10 12  1  1
 12 13  1  0
  9 14  1  6
  4 15  1  0
 15 16  1  0
  3 17  1  0
  1 18  2  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  1
 24 26  2  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5188258

    ---

Associated Targets(Human)

DNMT1 Tclin DNA (cytosine-5)-methyltransferase 1 (978 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.42Molecular Weight (Monoisotopic): 385.1961AlogP: -1.86#Rotatable Bonds: 10
Polar Surface Area: 185.95Molecular Species: ZWITTERIONHBA: 10HBD: 6
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 2.05CX Basic pKa: 9.53CX LogP: -5.00CX LogD: -5.91
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.25Np Likeness Score: 0.93

References

1. Lamiable-Oulaidi F, Harijan RK, Shaffer KJ, Crump DR, Sun Y, Du Q, Gulab SA, Khan AA, Luxenburger A, Woolhouse AD, Sidoli S, Tyler PC, Schramm VL..  (2022)  Synthesis and Characterization of Transition-State Analogue Inhibitors against Human DNA Methyltransferase 1.,  65  (7.0): [PMID:35324190] [10.1021/acs.jmedchem.1c01869]

Source