(4S,7S)-4-cyclopentyl-7-((R)-1-hydroxyethyl)-13-methyl-2,5,8,11,14,15-hexaoxo-3,6,9,12,16-pentaazanonadecan-19-oic acid

ID: ALA5188719

PubChem CID: 168279427

Max Phase: Preclinical

Molecular Formula: C22H35N5O9

Molecular Weight: 513.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)NC(C)C(=O)C(=O)NCCC(=O)O)[C@@H](C)O)C1CCCC1

Standard InChI:  InChI=1S/C22H35N5O9/c1-11(19(33)22(36)23-9-8-16(31)32)25-15(30)10-24-20(34)17(12(2)28)27-21(35)18(26-13(3)29)14-6-4-5-7-14/h11-12,14,17-18,28H,4-10H2,1-3H3,(H,23,36)(H,24,34)(H,25,30)(H,26,29)(H,27,35)(H,31,32)/t11?,12-,17+,18+/m1/s1

Standard InChI Key:  SUHVQOKCNZZZQQ-NXHIVTLCSA-N

Molfile:  

 
     RDKit          2D

 36 36  0  0  0  0  0  0  0  0999 V2000
   -6.7890   -0.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0746   -0.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0746    0.5803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3600   -0.6574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6453   -0.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9306   -0.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6453    0.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2160   -0.2448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9306   -1.4827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5013   -0.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7867   -0.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5013   -1.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7867   -1.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2160   -1.8952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7867    0.5803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0720   -0.6574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3574   -0.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3572   -0.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719   -0.2448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3572   -1.4827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7865   -0.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5011   -0.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7865   -1.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5011    0.5803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2158   -0.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9304   -0.2448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2158   -1.4827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6451   -0.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3597   -0.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0743   -0.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0743   -1.4827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7890   -0.2448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3599    0.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1745    1.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3730    1.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0409    1.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  1
  6  8  1  0
  6  9  2  0
  8 10  1  0
 10 11  1  6
 10 12  1  0
 12 13  1  0
 12 14  1  1
 11 15  2  0
 11 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 22 24  2  0
 22 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 33  7  1  0
 33 34  1  0
 34 35  1  0
 36 35  1  0
  7 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5188719

    ---

Associated Targets(non-human)

SUB1 Subtilisin-like protease (110 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.55Molecular Weight (Monoisotopic): 513.2435AlogP: -2.67#Rotatable Bonds: 14
Polar Surface Area: 220.10Molecular Species: ACIDHBA: 8HBD: 7
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.91CX Basic pKa: CX LogP: -2.83CX LogD: -6.05
Aromatic Rings: Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: -0.25

References

1. Lidumniece E, Withers-Martinez C, Hackett F, Blackman MJ, Jirgensons A..  (2022)  Subtilisin-like Serine Protease 1 (SUB1) as an Emerging Antimalarial Drug Target: Current Achievements in Inhibitor Discovery.,  65  (19.0): [PMID:36137276] [10.1021/acs.jmedchem.2c01093]

Source