(1R,2S)-Acetic acid (3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(3-oxo-2,7-dioxa-bicyclo[4.1.0]hept-4-en-6-yl)-hexadecahydro-20-oxa-cyclopropa[14,15]cyclopenta[a]phenanthren-3-yl ester

ID: ALA518900

PubChem CID: 44559573

Max Phase: Preclinical

Molecular Formula: C26H34O6

Molecular Weight: 442.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@@]45C=CC(=O)O[C@@H]4O5)C[C@H]4O[C@]342)C1

Standard InChI:  InChI=1S/C26H34O6/c1-14(27)29-16-6-9-23(2)15(12-16)4-5-18-17(23)7-10-24(3)19(13-20-26(18,24)31-20)25-11-8-21(28)30-22(25)32-25/h8,11,15-20,22H,4-7,9-10,12-13H2,1-3H3/t15-,16+,17+,18-,19+,20-,22-,23+,24-,25+,26-/m1/s1

Standard InChI Key:  FPSOKWLLCMWZPL-YOAQZPNYSA-N

Molfile:  

     RDKit          2D

 38 44  0  0  0  0  0  0  0  0999 V2000
    7.7042  -20.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7042  -21.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4162  -22.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4162  -20.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1282  -20.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1293  -21.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8403  -22.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5549  -21.7398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8382  -20.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5557  -20.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5545  -19.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8345  -19.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2720  -19.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5470  -20.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0619  -19.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1326  -18.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3912  -17.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8445  -17.0767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0355  -17.2434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1053  -16.2940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1208  -20.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1250  -22.5625    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9903  -22.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5500  -20.0875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8333  -21.3250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8833  -19.4208    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.0568  -20.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2710  -20.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4408  -21.3161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6375  -21.3458    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.8542  -18.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2752  -21.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5614  -22.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2740  -20.9187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3226  -18.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7704  -18.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5188  -18.8200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9417  -18.0292    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
  8 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 36  1  0
 15 35  1  0
  9 10  1  0
 18 20  2  0
  3  6  1  0
  5 21  1  1
  5  4  1  0
  6 22  1  1
  5  6  1  0
  2 23  1  1
 10 24  1  1
  9 12  1  0
  9 25  1  6
 10 28  1  0
 15 26  1  6
 28 27  1  0
 28 29  1  1
 27 29  1  0
 13 11  1  0
 11 12  1  0
 13 28  1  0
  1  2  1  0
 27 30  1  6
  1  4  1  0
 13 31  1  1
  2  3  1  0
 23 32  1  0
 27 14  1  0
 32 33  1  0
 14 15  1  0
 32 34  2  0
 36 35  1  0
 37 36  1  0
 35 37  1  1
 15 13  1  0
 35 16  1  0
  5  9  1  0
  6  7  1  0
 36 38  1  6
M  END

Associated Targets(non-human)

MH60 (82 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 442.55Molecular Weight (Monoisotopic): 442.2355AlogP: 3.92#Rotatable Bonds: 2
Polar Surface Area: 77.66Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.96CX LogD: 3.96
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: 3.42

References

1. Enomoto A, Rho MC, Komiyama K, Hayashi M..  (2004)  Inhibitory effects of bufadienolides on interleukin-6 in MH-60 cells.,  67  (12): [PMID:15620253] [10.1021/np049950e]

Source