The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-(tert-butyl)isoxazol-3-yl)-3-(4-(2-(3-(piperidin-1-yl)propyl)-4,5-dihydro-2H-imidazo[2',1':2,3]thiazolo[4,5-e]isoindol-8-yl)phenyl)urea ID: ALA5189185
PubChem CID: 168280071
Max Phase: Preclinical
Molecular Formula: C33H39N7O2S
Molecular Weight: 597.79
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3cn4c5c(sc4n3)CCc3cn(CCCN4CCCCC4)cc3-5)cc2)no1
Standard InChI: InChI=1S/C33H39N7O2S/c1-33(2,3)28-18-29(37-42-28)36-31(41)34-24-11-8-22(9-12-24)26-21-40-30-25-20-39(17-7-16-38-14-5-4-6-15-38)19-23(25)10-13-27(30)43-32(40)35-26/h8-9,11-12,18-21H,4-7,10,13-17H2,1-3H3,(H2,34,36,37,41)
Standard InChI Key: XERYTWVFKVCJHJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 49 0 0 0 0 0 0 0 0999 V2000
-2.8983 -2.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1839 -2.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4694 -2.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4694 -3.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1839 -4.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8983 -3.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6848 -4.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1999 -3.4067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6848 -2.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6248 -3.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0371 -2.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8619 -2.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2743 -1.9782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8619 -1.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2743 -0.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0990 -0.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5114 -1.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0990 -1.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3554 -1.7747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1758 -1.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5114 -2.4420 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.3472 -0.8816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6327 -0.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0199 -1.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6327 0.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3470 0.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3462 1.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6317 2.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9202 1.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9154 0.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6317 2.8276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9175 3.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2032 2.8276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9175 4.0648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4890 3.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4028 4.0598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4035 4.2312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8157 3.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2640 2.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6404 3.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0528 4.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6404 2.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3542 3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
4 7 2 0
8 7 1 0
9 8 1 0
3 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
13 18 1 0
2 19 1 0
20 19 1 0
21 20 1 0
1 21 1 0
20 22 2 0
22 23 1 0
23 24 2 0
19 24 1 0
25 23 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
28 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
36 35 2 0
36 37 1 0
37 38 1 0
38 39 2 0
39 35 1 0
38 40 1 0
40 41 1 0
40 42 1 0
40 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.79Molecular Weight (Monoisotopic): 597.2886AlogP: 7.44#Rotatable Bonds: 7Polar Surface Area: 92.63Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.26CX Basic pKa: 10.02CX LogP: 5.41CX LogD: 4.57Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.20Np Likeness Score: -1.66
References 1. Cilibrasi V, Spanò V, Bortolozzi R, Barreca M, Raimondi MV, Rocca R, Maruca A, Montalbano A, Alcaro S, Ronca R, Viola G, Barraja P.. (2022) Synthesis of 2H-Imidazo[2',1':2,3] [1,3]thiazolo[4,5-e]isoindol-8-yl-phenylureas with promising therapeutic features for the treatment of acute myeloid leukemia (AML) with FLT3/ITD mutations., 235 [PMID:35339838 ] [10.1016/j.ejmech.2022.114292 ]