The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3-(4-acetylpiperazin-1-yl)-5-fluoro-phenyl]-4-fluoro-7-methyl-1H-indole-2-carboxamide ID: ALA5189290
PubChem CID: 168281991
Max Phase: Preclinical
Molecular Formula: C22H22F2N4O2
Molecular Weight: 412.44
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCN(c2cc(F)cc(NC(=O)c3cc4c(F)ccc(C)c4[nH]3)c2)CC1
Standard InChI: InChI=1S/C22H22F2N4O2/c1-13-3-4-19(24)18-12-20(26-21(13)18)22(30)25-16-9-15(23)10-17(11-16)28-7-5-27(6-8-28)14(2)29/h3-4,9-12,26H,5-8H2,1-2H3,(H,25,30)
Standard InChI Key: DTKJRMMWEXPPEW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-4.2351 -1.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5205 -0.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8086 -1.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8086 -2.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5187 -2.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2351 -2.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0239 -2.3435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0239 -1.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5389 -1.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5205 -0.0262 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5187 -3.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7137 -1.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3011 -0.9613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3011 -2.3907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5240 -0.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9369 -0.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7596 -0.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1723 -0.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7631 -1.6743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9384 -1.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1721 0.4670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7596 1.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1721 1.8962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9974 1.8962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4099 1.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9974 0.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4099 2.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9974 3.3255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2351 2.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1757 -2.3889 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
3 8 1 0
8 9 2 0
9 7 1 0
2 10 1 0
5 11 1 0
9 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
21 17 1 0
21 22 1 0
23 22 1 0
24 23 1 0
25 24 1 0
21 26 1 0
26 25 1 0
24 27 1 0
27 28 2 0
27 29 1 0
19 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.44Molecular Weight (Monoisotopic): 412.1711AlogP: 3.68#Rotatable Bonds: 3Polar Surface Area: 68.44Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.94CX Basic pKa: 0.86CX LogP: 3.06CX LogD: 3.06Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.69Np Likeness Score: -1.88
References 1. Alford JS, Lampe JW, Brach D, Chesworth R, Cosmopoulos K, Duncan KW, Eckley ST, Kutok JL, Raimondi A, Riera TV, Shook B, Tang C, Totman J, Farrow NA.. (2022) Conformational-Design-Driven Discovery of EZM0414: A Selective, Potent SETD2 Inhibitor for Clinical Studies., 13 (7.0): [PMID:35859865 ] [10.1021/acsmedchemlett.2c00167 ]