(S)-4-(3,3-dimethylureido)-N-((2R,3R,5S,6S)-6-((5-((3R,4R,5R,7R)-4-hydroxy-7-methyl-1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dien-1-yl)-2,5-dimethyltetrahydro-2H-pyran-3-yl)pent-2-enamide

ID: ALA5189338

PubChem CID: 168282374

Max Phase: Preclinical

Molecular Formula: C28H45N3O6

Molecular Weight: 519.68

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(/C=C/[C@H]1O[C@H](C)C[C@@]2(CO2)[C@@H]1O)=C\C[C@@H]1O[C@H](C)[C@H](NC(=O)/C=C\[C@H](C)NC(=O)N(C)C)C[C@@H]1C

Standard InChI:  InChI=1S/C28H45N3O6/c1-17(9-12-24-26(33)28(16-35-28)15-20(4)36-24)8-11-23-18(2)14-22(21(5)37-23)30-25(32)13-10-19(3)29-27(34)31(6)7/h8-10,12-13,18-24,26,33H,11,14-16H2,1-7H3,(H,29,34)(H,30,32)/b12-9+,13-10-,17-8+/t18-,19-,20+,21+,22+,23-,24+,26+,28+/m0/s1

Standard InChI Key:  IPTCDASTQLZPPA-RKGLNNGISA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    6.0733   -1.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0733   -0.7706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7877   -0.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3587   -0.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3587    0.4668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6443   -0.7706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9298   -0.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2153   -0.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9298    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2153    0.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5008    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5008   -0.3581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7864    0.8794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0718    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0718   -0.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7864   -0.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574   -0.7705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570   -0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    0.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0715    0.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0714   -0.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7860   -0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5004   -0.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5004   -1.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2149   -0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9294   -0.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6439   -0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6439    0.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9294    0.8797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3585    0.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7702    1.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9453    1.5956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0733    0.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0733   -0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7877   -0.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3585   -0.7707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  4  2  1  0
  4  5  2  0
  6  4  1  0
  7  6  1  1
  7  8  1  0
  9  7  1  0
 10  9  2  0
 11 10  1  0
 11 12  2  0
 13 11  1  0
 14 13  1  1
 15 14  1  0
 15 16  1  1
 17 15  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 14 20  1  0
 19 21  1  1
 18 22  1  1
 23 22  1  0
 24 23  2  0
 24 25  1  0
 26 24  1  0
 27 26  2  0
 28 27  1  1
 28 29  1  0
 29 30  1  6
 29 31  1  0
 31 32  1  0
 33 32  1  0
 31 33  1  6
 34 31  1  0
 34 35  1  0
 35 36  1  6
 35 37  1  0
 37 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5189338

    ---

Associated Targets(Human)

MES-SA/Dx5 (643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MES-SA (905 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.68Molecular Weight (Monoisotopic): 519.3308AlogP: 2.70#Rotatable Bonds: 8
Polar Surface Area: 112.66Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.91CX Basic pKa: CX LogP: 1.60CX LogD: 1.60
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: 1.91

References

1. Ghosh AK, Mishevich JL, Jurica MS..  (2021)  Spliceostatins and Derivatives: Chemical Syntheses and Biological Properties of Potent Splicing Inhibitors.,  84  (5.0): [PMID:33974423] [10.1021/acs.jnatprod.1c00100]

Source