The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-difluorophenyl)-1,1-difluoro-3-(tetrazol-1-yl)-1-[5-[5-(2,2,2-trifluoroethoxy)-2-pyridyl]-2-pyridyl]propan-2-ol ID: ALA5189694
PubChem CID: 168283190
Max Phase: Preclinical
Molecular Formula: C22H15F7N6O2
Molecular Weight: 528.39
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OCC(F)(F)F)cn2)cn1
Standard InChI: InChI=1S/C22H15F7N6O2/c23-14-2-4-16(17(24)7-14)20(36,10-35-12-32-33-34-35)22(28,29)19-6-1-13(8-31-19)18-5-3-15(9-30-18)37-11-21(25,26)27/h1-9,12,36H,10-11H2
Standard InChI Key: ZRYGTVHMKZFXOZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-2.4372 -0.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7226 0.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0107 -0.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0107 -0.9733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7208 -1.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4372 -0.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2961 0.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2958 1.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4170 1.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1318 1.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1334 0.2665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4215 -0.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1518 -1.3896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8665 -0.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5811 -1.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2957 -0.9770 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5811 -2.2148 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.2957 -1.8022 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.8464 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5611 1.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2757 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9903 1.0876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2629 2.0836 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2590 2.2148 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5611 0.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7437 1.4230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2957 0.8101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8833 0.0958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0765 0.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5611 1.9127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2756 -0.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2748 -0.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -1.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8481 -0.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8433 -0.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6882 0.5642 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -2.2110 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 3 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
7 12 1 0
12 11 2 0
6 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
15 18 1 0
10 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
19 23 1 0
19 24 1 0
20 25 1 0
26 22 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 22 1 0
20 30 1 0
31 25 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
25 35 1 0
31 36 1 0
33 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.39Molecular Weight (Monoisotopic): 528.1145AlogP: 4.03#Rotatable Bonds: 8Polar Surface Area: 98.84Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.64CX Basic pKa: 3.49CX LogP: 3.86CX LogD: 3.86Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: -1.71
References 1. Beltran-Hortelano I, Alcolea V, Font M, Pérez-Silanes S.. (2022) Examination of multiple Trypanosoma cruzi targets in a new drug discovery approach for Chagas disease., 58 [PMID:35189560 ] [10.1016/j.bmc.2021.116577 ]