(4aR,10bR)-1-(tert-butoxycaronyl)-7-ethoxy-1,2,3,4,4a,5,6,10b-octahydrobenzo[h][1,6]naphthyridin-5-yl)benzoic acid

ID: ALA5189933

PubChem CID: 168283581

Max Phase: Preclinical

Molecular Formula: C28H34N2O6

Molecular Weight: 494.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1cccc2c1N(C(C)=O)[C@@H](c1ccc(C(=O)O)cc1)[C@H]1CCCN(C(=O)OC(C)(C)C)[C@@H]21

Standard InChI:  InChI=1S/C28H34N2O6/c1-6-35-22-11-7-9-21-24-20(10-8-16-29(24)27(34)36-28(3,4)5)23(30(17(2)31)25(21)22)18-12-14-19(15-13-18)26(32)33/h7,9,11-15,20,23-24H,6,8,10,16H2,1-5H3,(H,32,33)/t20-,23+,24-/m1/s1

Standard InChI Key:  FWLNWSLXIUVTGV-FGCOXFRFSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   -3.1707   -0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4561    0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7442   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7442   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4543   -1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1707   -1.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4543   -2.2685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1689   -2.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1689   -3.5063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0296   -1.4441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3149   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3149   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0296    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3996   -1.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1144   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8265   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8265   -2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1163   -2.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3996   -2.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0296   -2.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3149   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7442   -2.6819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0295    1.0314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3148    1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3997    1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3997    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6131    0.7897    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5102   -0.2063    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7442    1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4588    1.0314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7442    2.2692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4588    2.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4588    3.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2558    2.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6723    1.8847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5412   -2.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5412   -3.5070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2558   -2.2692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  3 13  1  0
 11 14  1  6
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 10 20  1  0
 20 21  1  0
 20 22  2  0
 13 23  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 12 26  1  0
 13 27  1  1
 12 28  1  1
 23 29  1  0
 29 30  2  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
 36 17  1  0
 36 37  1  0
 36 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5189933

    ---

Associated Targets(Human)

JAR (316 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.59Molecular Weight (Monoisotopic): 494.2417AlogP: 5.58#Rotatable Bonds: 4
Polar Surface Area: 96.38Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.06CX Basic pKa: CX LogP: 3.96CX LogD: 0.84
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.60Np Likeness Score: -0.32

References

1. Goebel GL, Hohnen L, Borgelt L, Hommen P, Qiu X, Lightfoot H, Wu P..  (2022)  Small molecules with tetrahydroquinoline-containing Povarov scaffolds as inhibitors disrupting the Protein-RNA interaction of LIN28-let-7.,  228  [PMID:34883291] [10.1016/j.ejmech.2021.114014]

Source