The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-benzyl-4-(N-phenylsulfamoyl)-N-((1-(pyridin-4-ylmethyl)-1H-1,2,3-triazol-4-yl)methyl)benzamide ID: ALA5190028
PubChem CID: 168279052
Max Phase: Preclinical
Molecular Formula: C29H26N6O3S
Molecular Weight: 538.63
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(S(=O)(=O)Nc2ccccc2)cc1)N(Cc1ccccc1)Cc1cn(Cc2ccncc2)nn1
Standard InChI: InChI=1S/C29H26N6O3S/c36-29(25-11-13-28(14-12-25)39(37,38)32-26-9-5-2-6-10-26)34(19-23-7-3-1-4-8-23)21-27-22-35(33-31-27)20-24-15-17-30-18-16-24/h1-18,22,32H,19-21H2
Standard InChI Key: BGLPPRDDOZREKL-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
4.2059 3.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0309 3.3417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4425 2.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0346 1.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2062 1.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7941 2.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7938 1.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9691 1.2013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4985 1.8546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6948 1.6046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6948 0.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4773 0.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9806 0.3674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9806 -0.4572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6948 -0.8696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6948 -1.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4090 -2.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4082 -2.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6938 -3.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9822 -2.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9775 -2.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2663 -0.8696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2663 -1.6943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4478 -0.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4478 0.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1596 0.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8740 0.3673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5883 0.7796 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1751 1.4953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3025 0.3673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0168 0.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0168 1.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7283 2.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4425 1.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4425 0.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7265 0.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9998 1.4953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8740 -0.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1578 -0.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
7 5 1 0
8 7 1 0
9 8 1 0
10 9 2 0
10 11 1 0
11 12 2 0
12 8 1 0
13 11 1 0
14 13 1 0
14 15 1 0
15 16 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
21 20 2 0
16 21 1 0
22 14 1 0
22 23 2 0
24 22 1 0
24 25 2 0
25 26 1 0
26 27 2 0
28 27 1 0
28 29 2 0
30 28 1 0
31 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
28 37 2 0
27 38 1 0
38 39 2 0
39 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.63Molecular Weight (Monoisotopic): 538.1787AlogP: 4.36#Rotatable Bonds: 10Polar Surface Area: 110.08Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.63CX Basic pKa: 5.18CX LogP: 3.84CX LogD: 3.67Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -1.93
References 1. Hanke T, Mathea S, Woortman J, Salah E, Berger BT, Tumber A, Kashima R, Hata A, Kuster B, Müller S, Knapp S.. (2022) Development and Characterization of Type I, Type II, and Type III LIM-Kinase Chemical Probes., 65 (19.0): [PMID:36136092 ] [10.1021/acs.jmedchem.2c01106 ]