The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-ethyl-5-fluoro-1H-indol-3-yl)-4-(3-(2-(fluoro-18F)ethoxy)phenyl)-1H-pyrrole-2,5-dione ID: ALA5190086
PubChem CID: 168283625
Max Phase: Preclinical
Molecular Formula: C22H18F2N2O3
Molecular Weight: 396.39
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C2=C(c3cccc(OCC[18F])c3)C(=O)NC2=O)c2cc(F)ccc21
Standard InChI: InChI=1S/C22H18F2N2O3/c1-2-26-12-17(16-11-14(24)6-7-18(16)26)20-19(21(27)25-22(20)28)13-4-3-5-15(10-13)29-9-8-23/h3-7,10-12H,2,8-9H2,1H3,(H,25,27,28)/i23-1
Standard InChI Key: YCVNCXIPRCVVBB-VNRZBHCFSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
0.0287 0.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7962 0.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0464 1.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3928 2.1659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2745 1.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0712 1.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8432 1.9087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2087 0.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7962 -0.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3673 -1.1557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1016 -0.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0093 -0.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6796 0.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4367 0.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5266 -0.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8590 -1.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1539 -1.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4410 0.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2659 0.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6764 -0.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2639 -1.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4431 -1.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0269 -0.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1510 0.5681 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.3571 -2.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5013 -0.5358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9137 -1.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7385 -1.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1510 -1.9644 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
5 4 1 0
1 5 1 0
5 6 2 0
3 7 2 0
8 2 1 0
8 9 2 0
9 10 1 0
10 11 1 0
12 11 2 0
8 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
11 16 1 0
10 17 1 0
18 1 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
14 24 1 0
17 25 1 0
20 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
M ISO 1 29 18
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.39Molecular Weight (Monoisotopic): 396.1285AlogP: 3.72#Rotatable Bonds: 6Polar Surface Area: 60.33Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.92CX Basic pKa: ┄CX LogP: 3.57CX LogD: 3.56Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.65Np Likeness Score: -0.95
References 1. Chen Z, Haider A, Chen J, Xiao Z, Gobbi L, Honer M, Grether U, Arnold SE, Josephson L, Liang SH.. (2021) The Repertoire of Small-Molecule PET Probes for Neuroinflammation Imaging: Challenges and Opportunities beyond TSPO., 64 (24.0): [PMID:34905377 ] [10.1021/acs.jmedchem.1c01571 ]