3-(1-ethyl-5-fluoro-1H-indol-3-yl)-4-(3-(2-(fluoro-18F)ethoxy)phenyl)-1H-pyrrole-2,5-dione

ID: ALA5190086

PubChem CID: 168283625

Max Phase: Preclinical

Molecular Formula: C22H18F2N2O3

Molecular Weight: 396.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCn1cc(C2=C(c3cccc(OCC[18F])c3)C(=O)NC2=O)c2cc(F)ccc21

Standard InChI:  InChI=1S/C22H18F2N2O3/c1-2-26-12-17(16-11-14(24)6-7-18(16)26)20-19(21(27)25-22(20)28)13-4-3-5-15(10-13)29-9-8-23/h3-7,10-12H,2,8-9H2,1H3,(H,25,27,28)/i23-1

Standard InChI Key:  YCVNCXIPRCVVBB-VNRZBHCFSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    0.0287    0.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7962    0.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0464    1.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3928    2.1659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2745    1.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712    1.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8432    1.9087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2087    0.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7962   -0.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3673   -1.1557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1016   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0093   -0.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6796    0.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4367    0.1558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5266   -0.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8590   -1.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1539   -1.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4410    0.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2659    0.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6764   -0.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2639   -1.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4431   -1.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0269   -0.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1510    0.5681    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3571   -2.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5013   -0.5358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9137   -1.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7385   -1.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1510   -1.9644    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  5  6  2  0
  3  7  2  0
  8  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 12 11  2  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 11 16  1  0
 10 17  1  0
 18  1  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 14 24  1  0
 17 25  1  0
 20 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
M  ISO  1  29  18
M  END

Associated Targets(Human)

GSK3A Tclin Glycogen synthase kinase-3 (736 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.39Molecular Weight (Monoisotopic): 396.1285AlogP: 3.72#Rotatable Bonds: 6
Polar Surface Area: 60.33Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.92CX Basic pKa: CX LogP: 3.57CX LogD: 3.56
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.65Np Likeness Score: -0.95

References

1. Chen Z, Haider A, Chen J, Xiao Z, Gobbi L, Honer M, Grether U, Arnold SE, Josephson L, Liang SH..  (2021)  The Repertoire of Small-Molecule PET Probes for Neuroinflammation Imaging: Challenges and Opportunities beyond TSPO.,  64  (24.0): [PMID:34905377] [10.1021/acs.jmedchem.1c01571]

Source