The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-(3-([1,1'-biphenyl]-4-yl)propanamido)-5-(((S)-1-amino-4-carboxy-1-oxobutan-2-yl)amino)-5-oxopentanoic acid ID: ALA5190158
PubChem CID: 168283672
Max Phase: Preclinical
Molecular Formula: C25H29N3O7
Molecular Weight: 483.52
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCC(=O)O)NC(=O)CCc1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C25H29N3O7/c26-24(34)19(11-14-22(30)31)28-25(35)20(12-15-23(32)33)27-21(29)13-8-16-6-9-18(10-7-16)17-4-2-1-3-5-17/h1-7,9-10,19-20H,8,11-15H2,(H2,26,34)(H,27,29)(H,28,35)(H,30,31)(H,32,33)/t19-,20+/m0/s1
Standard InChI Key: KGICPKKIUBLFER-VQTJNVASSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
-2.1405 1.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4261 2.0602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1405 0.8224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8552 2.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5700 1.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5700 0.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7114 1.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0028 2.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7114 0.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0028 2.8847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7170 1.6475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4313 2.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1456 1.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4313 2.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7170 3.2970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1456 3.2970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8598 2.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5741 1.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2882 2.0599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5741 0.8228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0028 0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0028 -0.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7170 -0.8266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7114 -0.8266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8558 0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 -0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5710 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2825 -0.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2872 0.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5710 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8569 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8576 -2.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5721 -3.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2836 -2.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2882 -2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
4 5 1 0
5 6 1 0
2 7 1 0
7 8 1 0
7 9 1 1
8 10 2 0
8 11 1 0
11 12 1 0
12 13 1 6
12 14 1 0
14 15 1 0
14 16 2 0
13 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
9 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
25 6 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
6 29 1 0
30 27 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
30 35 1 0
35 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.52Molecular Weight (Monoisotopic): 483.2006AlogP: 1.47#Rotatable Bonds: 14Polar Surface Area: 175.89Molecular Species: ACIDHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.83CX Basic pKa: ┄CX LogP: 1.12CX LogD: -5.04Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.08
References 1. Baidya SK, Banerjee S, Adhikari N, Jha T.. (2022) Selective Inhibitors of Medium-Size S1' Pocket Matrix Metalloproteinases: A Stepping Stone of Future Drug Discovery., 65 (16.0): [PMID:35969157 ] [10.1021/acs.jmedchem.1c01855 ]