The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-acetylindolin-5-yl)-2-methoxy-5-(trifluoromethyl)benzenesulfonamide ID: ALA5190159
PubChem CID: 168283673
Max Phase: Preclinical
Molecular Formula: C18H17F3N2O4S
Molecular Weight: 414.41
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(F)(F)F)cc1S(=O)(=O)Nc1ccc2c(c1)CCN2C(C)=O
Standard InChI: InChI=1S/C18H17F3N2O4S/c1-11(24)23-8-7-12-9-14(4-5-15(12)23)22-28(25,26)17-10-13(18(19,20)21)3-6-16(17)27-2/h3-6,9-10,22H,7-8H2,1-2H3
Standard InChI Key: HAALTGNLZKPPHA-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-1.6607 -0.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9461 0.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2343 -0.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2343 -1.1900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9443 -1.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6607 -1.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4487 -1.4497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9356 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4486 -0.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6630 -2.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0774 -2.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4631 -2.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4829 0.0492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2002 -0.3648 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.9176 0.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9178 0.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6333 1.2897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3508 0.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3524 0.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6379 -0.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7853 -1.0834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6135 -1.0834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6379 -1.1948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3552 -1.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6333 2.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9160 2.5322 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.4631 2.1180 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.0474 2.8354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
1 9 1 0
7 10 1 0
10 11 1 0
10 12 2 0
3 13 1 0
13 14 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
14 21 2 0
14 22 2 0
20 23 1 0
23 24 1 0
17 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.41Molecular Weight (Monoisotopic): 414.0861AlogP: 3.42#Rotatable Bonds: 4Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.99CX Basic pKa: ┄CX LogP: 2.32CX LogD: 1.88Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.83Np Likeness Score: -1.91
References 1. Xiang Q, Luo G, Zhang C, Hu Q, Wang C, Wu T, Xu H, Hu J, Zhuang X, Zhang M, Wu S, Xu J, Zhang Y, Liu J, Xu Y.. (2022) Discovery, optimization and evaluation of 1-(indolin-1-yl)ethan-1-ones as novel selective TRIM24/BRPF1 bromodomain inhibitors., 236 [PMID:35385803 ] [10.1016/j.ejmech.2022.114311 ]