The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(4-(3,3,3-trifluoro-1-(phenylsulfonyl)prop-1-en-1-yl)phenyl)ethan-1-one ID: ALA5190386
PubChem CID: 164055293
Max Phase: Preclinical
Molecular Formula: C17H13F3O3S
Molecular Weight: 354.35
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1ccc(/C(=C\C(F)(F)F)S(=O)(=O)c2ccccc2)cc1
Standard InChI: InChI=1S/C17H13F3O3S/c1-12(21)13-7-9-14(10-8-13)16(11-17(18,19)20)24(22,23)15-5-3-2-4-6-15/h2-11H,1H3/b16-11+
Standard InChI Key: WCCPKGDHFVGNEL-LFIBNONCSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
-0.3584 -1.7039 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3560 -1.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0707 -1.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0730 -1.2911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7717 -2.4198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0533 -2.4198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7878 -1.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4998 -1.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4998 -0.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7896 -0.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0730 -0.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3560 -0.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3585 -0.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3577 0.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3570 1.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0689 0.7728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0737 -0.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3570 2.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3575 2.4198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 2.4198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7853 -1.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 -1.7040 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.7853 -0.4662 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 -0.8788 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
1 4 1 0
1 5 2 0
1 6 2 0
7 4 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
4 11 1 0
2 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 2 0
18 20 1 0
3 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 354.35Molecular Weight (Monoisotopic): 354.0537AlogP: 4.27#Rotatable Bonds: 4Polar Surface Area: 51.21Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.52CX LogD: 3.52Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.77Np Likeness Score: -0.60