The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((5Z)-5-[3-(Allyloxy)benzylidene]-4-oxo-2-thioxothiazolidin-3-yl]-1-(4-chlorophenyl)pyrrolidine-2,5-dione ID: ALA5190433
PubChem CID: 168058219
Max Phase: Preclinical
Molecular Formula: C23H17ClN2O4S2
Molecular Weight: 484.99
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOc1cccc(/C=C2\SC(=S)N(C3CC(=O)N(c4ccc(Cl)cc4)C3=O)C2=O)c1
Standard InChI: InChI=1S/C23H17ClN2O4S2/c1-2-10-30-17-5-3-4-14(11-17)12-19-22(29)26(23(31)32-19)18-13-20(27)25(21(18)28)16-8-6-15(24)7-9-16/h2-9,11-12,18H,1,10,13H2/b19-12-
Standard InChI Key: OGPJVFDQWRHEHV-UNOMPAQXSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
0.3420 1.9839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2599 1.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5336 0.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9440 1.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3967 2.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5608 3.1332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8619 0.2600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4515 -0.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0261 -1.0807 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.7649 -0.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6828 0.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2848 0.6158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4764 -1.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4764 -1.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7649 -2.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7649 -3.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4764 -3.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1878 -3.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1878 -2.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3420 -0.5608 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.8619 0.6158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0533 2.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0533 3.2153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7649 3.6257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4764 3.2153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4764 2.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7649 1.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1878 3.6257 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.0536 -3.6257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3423 -3.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3689 -3.6257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0803 -3.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
5 6 2 0
3 7 1 0
8 7 1 0
9 8 1 0
9 10 1 0
7 11 1 0
11 10 1 0
11 12 2 0
10 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
8 20 2 0
2 21 2 0
1 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
25 28 1 0
16 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.99Molecular Weight (Monoisotopic): 484.0318AlogP: 4.44#Rotatable Bonds: 6Polar Surface Area: 66.92Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.41CX Basic pKa: ┄CX LogP: 4.83CX LogD: 4.54Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -1.46
References 1. Finiuk N, Kryshchyshyn-Dylevych A, Holota S, Klyuchivska O, Kozytskiy A, Karpenko O, Manko N, Ivasechko I, Stoika R, Lesyk R.. (2022) Novel hybrid pyrrolidinedione-thiazolidinones as potential anticancer agents: Synthesis and biological evaluation., 238 [PMID:35533562 ] [10.1016/j.ejmech.2022.114422 ]