The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-((2-aminoquinazolin-4-yl)amino)hexyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide ID: ALA5190517
PubChem CID: 168280119
Max Phase: Preclinical
Molecular Formula: C24H35N7O2S
Molecular Weight: 485.66
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(NCCCCCCNC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)c2ccccc2n1
Standard InChI: InChI=1S/C24H35N7O2S/c25-23-28-17-10-4-3-9-16(17)22(31-23)27-14-8-2-1-7-13-26-20(32)12-6-5-11-19-21-18(15-34-19)29-24(33)30-21/h3-4,9-10,18-19,21H,1-2,5-8,11-15H2,(H,26,32)(H2,29,30,33)(H3,25,27,28,31)/t18-,19-,21-/m0/s1
Standard InChI Key: KGTQKLNGKSIFIW-ZJOUEHCJSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
4.1342 -0.6998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8488 -0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5607 -0.6994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5607 -1.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8506 -1.9363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1342 -1.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2734 -0.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9883 -0.7010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9901 -1.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2785 -1.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4196 -1.9409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8488 0.5371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1346 0.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4204 0.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7062 0.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9921 0.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2778 0.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5637 0.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1504 0.9494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8646 0.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5788 0.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8646 -0.2875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2930 0.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0071 0.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7214 0.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4356 0.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1886 0.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7401 1.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3280 1.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5217 1.7691 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-6.4931 0.8915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6007 -0.0995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4070 0.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1525 1.9409 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.4743 0.2018 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-6.9901 -0.5113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
4 10 1 0
6 11 1 0
2 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
26 25 1 1
27 26 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
28 31 1 0
27 32 1 0
32 33 1 0
33 31 1 0
28 34 1 6
27 35 1 6
33 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.66Molecular Weight (Monoisotopic): 485.2573AlogP: 3.03#Rotatable Bonds: 13Polar Surface Area: 134.06Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.49CX Basic pKa: 7.18CX LogP: 2.37CX LogD: 2.26Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.22Np Likeness Score: -0.83
References 1. Wang FC, Peng B, Ren TT, Liu SP, Du JR, Chen ZH, Zhang TT, Gu X, Li M, Cao SL, Xu X.. (2022) A 1,2,3-Triazole Derivative of Quinazoline Exhibits Antitumor Activity by Tethering RNF168 to SQSTM1/P62., 65 (22.0): [PMID:36331508 ] [10.1021/acs.jmedchem.2c00432 ]