The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-dimethoxyphenyl)-3,7-dimethoxy-5-(4-(piperidin-1-yl)butoxy)-4H-chromen-4-one ID: ALA5190538
PubChem CID: 168281571
Max Phase: Preclinical
Molecular Formula: C28H35NO7
Molecular Weight: 497.59
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OCCCCN2CCCCC2)c2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1
Standard InChI: InChI=1S/C28H35NO7/c1-31-20-17-23(35-15-9-8-14-29-12-6-5-7-13-29)25-24(18-20)36-27(28(34-4)26(25)30)19-10-11-21(32-2)22(16-19)33-3/h10-11,16-18H,5-9,12-15H2,1-4H3
Standard InChI Key: KMGNADAGJAYJKI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-3.2147 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7857 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7857 1.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0694 1.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0694 0.2075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7840 -0.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7840 -1.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4984 -1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4984 -2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2129 -2.6798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2129 -3.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9273 -3.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6418 -3.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6418 -2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9273 -2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3595 1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3548 1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3548 0.2067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0693 1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7837 1.0317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4982 1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0693 2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7837 2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5012 2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2129 2.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9273 2.2713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6418 2.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2129 3.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9258 3.9172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6402 3.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4965 3.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7837 3.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3548 2.6817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3595 2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0713 2.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
11 16 1 0
5 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
20 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
30 31 1 0
29 32 2 0
32 33 1 0
33 24 2 0
23 34 1 0
35 34 1 0
17 35 2 0
35 36 1 0
36 3 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.59Molecular Weight (Monoisotopic): 497.2414AlogP: 5.14#Rotatable Bonds: 11Polar Surface Area: 79.60Molecular Species: BASEHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.01CX LogP: 3.65CX LogD: 2.04Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: 0.15
References 1. Rangel VM, Gu L, Chen G, Chen QH, Xue L.. (2022) 5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands., 61 [PMID:35143982 ] [10.1016/j.bmcl.2022.128608 ]