2-(3,4-dimethoxyphenyl)-3,7-dimethoxy-5-(4-(piperidin-1-yl)butoxy)-4H-chromen-4-one

ID: ALA5190538

PubChem CID: 168281571

Max Phase: Preclinical

Molecular Formula: C28H35NO7

Molecular Weight: 497.59

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(OCCCCN2CCCCC2)c2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1

Standard InChI:  InChI=1S/C28H35NO7/c1-31-20-17-23(35-15-9-8-14-29-12-6-5-7-13-29)25-24(18-20)36-27(28(34-4)26(25)30)19-10-11-21(32-2)22(16-19)33-3/h10-11,16-18H,5-9,12-15H2,1-4H3

Standard InChI Key:  KMGNADAGJAYJKI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -3.2147    2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002    2.6812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857    2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857    1.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0694    1.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0694    0.2075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7840   -0.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7840   -1.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984   -1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984   -2.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2129   -2.6798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2129   -3.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9273   -3.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6418   -3.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6418   -2.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9273   -2.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3595    1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3548    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3548    0.2067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0693    1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7837    1.0317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4982    1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0693    2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7837    2.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5012    2.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2129    2.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9273    2.2713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6418    2.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2129    3.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9258    3.9172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6402    3.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4965    3.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7837    3.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3548    2.6817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3595    2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0713    2.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 11 16  1  0
  5 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  2  0
 32 33  1  0
 33 24  2  0
 23 34  1  0
 35 34  1  0
 17 35  2  0
 35 36  1  0
 36  3  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5190538

    ---

Associated Targets(Human)

dsDNA (365 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.59Molecular Weight (Monoisotopic): 497.2414AlogP: 5.14#Rotatable Bonds: 11
Polar Surface Area: 79.60Molecular Species: BASEHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.01CX LogP: 3.65CX LogD: 2.04
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: 0.15

References

1. Rangel VM, Gu L, Chen G, Chen QH, Xue L..  (2022)  5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands.,  61  [PMID:35143982] [10.1016/j.bmcl.2022.128608]

Source