The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4S,5R)-3-((5-(3,5-difluorophenyl)benzo[d]isothiazole-3-carbonyl)-L-valyl)-N,2,2,5-tetramethyloxazolidine-4-carboxamide ID: ALA5190587
PubChem CID: 168281608
Max Phase: Preclinical
Molecular Formula: C27H30F2N4O4S
Molecular Weight: 544.62
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)[C@@H]1[C@@H](C)OC(C)(C)N1C(=O)[C@@H](NC(=O)c1nsc2ccc(-c3cc(F)cc(F)c3)cc12)C(C)C
Standard InChI: InChI=1S/C27H30F2N4O4S/c1-13(2)21(26(36)33-23(25(35)30-6)14(3)37-27(33,4)5)31-24(34)22-19-11-15(7-8-20(19)38-32-22)16-9-17(28)12-18(29)10-16/h7-14,21,23H,1-6H3,(H,30,35)(H,31,34)/t14-,21+,23+/m1/s1
Standard InChI Key: DPKSNUQWBQASKU-ZGFCVWDJSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
0.2064 2.4441 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5782 2.1892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5782 1.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2064 1.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6913 1.7766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4199 0.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2169 0.0986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4304 -0.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2274 -0.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8109 -0.3284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6818 0.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4167 0.8605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9998 0.2773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6254 -0.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0380 -1.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8630 -1.1720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6254 -1.8865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0380 -2.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7968 0.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2685 1.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8560 0.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4410 -1.7088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8470 -1.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0605 -2.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0500 -1.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1634 -0.2711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2882 0.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0045 1.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0045 2.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2900 2.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7191 0.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7191 0.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4321 -0.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1484 0.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1484 0.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4367 1.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8630 1.3583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.4321 -1.1129 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
3 4 1 0
5 4 2 0
1 5 1 0
4 6 1 0
6 7 1 0
8 7 1 6
8 9 1 0
9 10 1 0
11 10 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
14 15 1 1
15 16 2 0
15 17 1 0
17 18 1 0
13 19 1 6
11 20 1 0
11 21 1 0
9 22 2 0
8 23 1 0
23 24 1 0
23 25 1 0
6 26 2 0
27 3 1 0
28 27 2 0
29 28 1 0
30 29 2 0
2 30 1 0
31 28 1 0
32 31 2 0
33 32 1 0
34 33 2 0
35 34 1 0
36 35 2 0
31 36 1 0
35 37 1 0
33 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.62Molecular Weight (Monoisotopic): 544.1956AlogP: 4.09#Rotatable Bonds: 6Polar Surface Area: 100.63Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.49CX Basic pKa: ┄CX LogP: 3.90CX LogD: 3.90Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.49Np Likeness Score: -0.76
References 1. Proj M, Bozovičar K, Hrast M, Frlan R, Gobec S.. (2022) DNA-encoded library screening on two validated enzymes of the peptidoglycan biosynthetic pathway., 73 [PMID:35917835 ] [10.1016/j.bmcl.2022.128915 ]