(4S,5R)-3-((5-(3,5-difluorophenyl)benzo[d]isothiazole-3-carbonyl)-L-valyl)-N,2,2,5-tetramethyloxazolidine-4-carboxamide

ID: ALA5190587

PubChem CID: 168281608

Max Phase: Preclinical

Molecular Formula: C27H30F2N4O4S

Molecular Weight: 544.62

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)[C@@H]1[C@@H](C)OC(C)(C)N1C(=O)[C@@H](NC(=O)c1nsc2ccc(-c3cc(F)cc(F)c3)cc12)C(C)C

Standard InChI:  InChI=1S/C27H30F2N4O4S/c1-13(2)21(26(36)33-23(25(35)30-6)14(3)37-27(33,4)5)31-24(34)22-19-11-15(7-8-20(19)38-32-22)16-9-17(28)12-18(29)10-16/h7-14,21,23H,1-6H3,(H,30,35)(H,31,34)/t14-,21+,23+/m1/s1

Standard InChI Key:  DPKSNUQWBQASKU-ZGFCVWDJSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    0.2064    2.4441    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5782    2.1892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5782    1.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2064    1.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6913    1.7766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4199    0.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2169    0.0986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4304   -0.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2274   -0.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8109   -0.3284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6818    0.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4167    0.8605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9998    0.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6254   -0.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0380   -1.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8630   -1.1720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6254   -1.8865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0380   -2.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7968    0.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2685    1.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8560    0.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4410   -1.7088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8470   -1.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0605   -2.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0500   -1.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1634   -0.2711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2882    0.9524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0045    1.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0045    2.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2900    2.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7191    0.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7191    0.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4321   -0.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1484    0.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1484    0.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4367    1.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8630    1.3583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4321   -1.1129    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  3  4  1  0
  5  4  2  0
  1  5  1  0
  4  6  1  0
  6  7  1  0
  8  7  1  6
  8  9  1  0
  9 10  1  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 10  1  0
 14 15  1  1
 15 16  2  0
 15 17  1  0
 17 18  1  0
 13 19  1  6
 11 20  1  0
 11 21  1  0
  9 22  2  0
  8 23  1  0
 23 24  1  0
 23 25  1  0
  6 26  2  0
 27  3  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
  2 30  1  0
 31 28  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 35 34  1  0
 36 35  2  0
 31 36  1  0
 35 37  1  0
 33 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5190587

    ---

Associated Targets(non-human)

ddlB D-alanylalanine synthetase (66 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.62Molecular Weight (Monoisotopic): 544.1956AlogP: 4.09#Rotatable Bonds: 6
Polar Surface Area: 100.63Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.49CX Basic pKa: CX LogP: 3.90CX LogD: 3.90
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.49Np Likeness Score: -0.76

References

1. Proj M, Bozovičar K, Hrast M, Frlan R, Gobec S..  (2022)  DNA-encoded library screening on two validated enzymes of the peptidoglycan biosynthetic pathway.,  73  [PMID:35917835] [10.1016/j.bmcl.2022.128915]

Source