1,3-Bis(4-fluorophenyl)urea

ID: ALA5190669

Cas Number: 370-22-9

PubChem CID: 302982

Product Number: B152710, Order Now?

Max Phase: Preclinical

Molecular Formula: C13H10F2N2O

Molecular Weight: 248.23

In stock!

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(F)cc1)Nc1ccc(F)cc1

Standard InChI:  InChI=1S/C13H10F2N2O/c14-9-1-5-11(6-2-9)16-13(18)17-12-7-3-10(15)4-8-12/h1-8H,(H2,16,17,18)

Standard InChI Key:  VEURDHASKSZBOL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   -3.5762   -0.8282    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8623   -0.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1465   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4307   -0.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4307    0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1465    0.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8623    0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7150    0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0018    0.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0018   -0.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138    0.8208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4272    0.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4272   -0.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1429   -0.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8611   -0.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5762   -0.8303    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8611    0.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1454    0.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  5  6  1  0
  2  7  1  0
  7  6  2  0
  5  8  1  0
  9  8  1  0
  9 10  2  0
  9 11  1  0
 12 11  1  0
 12 13  2  0
 14 13  1  0
 15 14  2  0
 15 16  1  0
 17 15  1  0
 18 17  2  0
 12 18  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

LAD2 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 248.23Molecular Weight (Monoisotopic): 248.0761AlogP: 3.61#Rotatable Bonds: 2
Polar Surface Area: 41.13Molecular Species: NEUTRALHBA: 1HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.72CX Basic pKa: CX LogP: 3.40CX LogD: 3.40
Aromatic Rings: 2Heavy Atoms: 18QED Weighted: 0.84Np Likeness Score: -1.38

References

1. Wang C, Hu T, Lu J, Lv Y, Ge S, Hou Y, He H..  (2022)  Convenient Diaryl Ureas as Promising Anti-pseudo-allergic Agents.,  65  (15.0): [PMID:35876064] [10.1021/acs.jmedchem.2c00846]

Source