5-((1-(3-oxo-3-(3-(trifluoromethyl)-5a,6,8,9-tetrahydropyrido[3',2':4,5]imidazo[1,2-a]pyrazin-7(5H)-yl)propoxy)propan-2-yl)oxy)-4-(trifluoromethyl)pyridazin-3(2H)-one

ID: ALA5190796

PubChem CID: 168283638

Max Phase: Preclinical

Molecular Formula: C21H22F6N6O4

Molecular Weight: 536.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3NC2C1)Oc1cn[nH]c(=O)c1C(F)(F)F

Standard InChI:  InChI=1S/C21H22F6N6O4/c1-11(37-14-8-29-31-19(35)17(14)21(25,26)27)10-36-5-2-16(34)32-3-4-33-15(9-32)30-13-6-12(20(22,23)24)7-28-18(13)33/h6-8,11,15,30H,2-5,9-10H2,1H3,(H,31,35)

Standard InChI Key:  ZPVDTDPKQSCYAJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -3.8218    1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1073    1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3929    1.0309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3929    0.2059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1073   -0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8218    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5359   -0.2063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5359   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2502   -1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8218   -1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1075   -1.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3934   -1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6792   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9649   -1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2507   -1.0310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2507   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4633    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1775   -0.2064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1775   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4633   -1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9649   -2.2679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1073    2.2679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5359    1.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2502    1.0309    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5359    2.2679    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2502    1.8556    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9618   -1.2859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9618    0.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4464   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2968    0.7992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1170    0.8856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6007    0.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2700   -0.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4255    0.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8378    0.9370    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.8378   -0.4913    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.2502    0.2228    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 15 20  1  0
 14 21  2  0
  2 22  2  0
  1 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
 19 27  1  0
 18 28  1  0
 28 29  2  0
 29 27  1  0
 28 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 29 33  1  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5190796

    ---

Associated Targets(Human)

TIPARP Tbio TCDD-inducible poly [ADP-ribose] polymerase (41 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.43Molecular Weight (Monoisotopic): 536.1607AlogP: 2.48#Rotatable Bonds: 7
Polar Surface Area: 112.68Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.99CX Basic pKa: 4.78CX LogP: 1.42CX LogD: 1.42
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -1.24

References

1. Kargbo RB..  (2022)  Recent Discovery of PARP7 Inhibitors as Anticancer Agents.,  13  (11.0): [PMID:36385937] [10.1021/acsmedchemlett.2c00416]

Source