The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(furan-2-yl)-1-(4-((5-(quinolin-8-yloxy)pentyl)oxy)phenyl)prop-2-en-1-one ID: ALA5190983
PubChem CID: 132280742
Max Phase: Preclinical
Molecular Formula: C27H25NO4
Molecular Weight: 427.50
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccco1)c1ccc(OCCCCCOc2cccc3cccnc23)cc1
Standard InChI: InChI=1S/C27H25NO4/c29-25(16-15-23-9-6-20-31-23)21-11-13-24(14-12-21)30-18-2-1-3-19-32-26-10-4-7-22-8-5-17-28-27(22)26/h4-17,20H,1-3,18-19H2/b16-15+
Standard InChI Key: ZGIMXCDPPOICNU-FOCLMDBBSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-6.7217 -0.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0072 -0.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2953 -0.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2953 -1.4402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0054 -1.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7217 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0058 0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2931 1.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5839 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5797 -0.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8673 -0.6139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1549 -0.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4425 -0.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7301 -0.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0177 -0.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3053 -0.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4069 -0.6139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1195 -0.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1197 0.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8304 1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5430 0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5445 -0.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8349 -0.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2553 1.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2553 1.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9678 0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6802 1.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3926 0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1050 1.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7217 0.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3922 -0.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5706 -0.1802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
2 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
3 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
21 24 1 0
24 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
29 28 2 0
29 30 1 0
30 31 2 0
32 31 1 0
28 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.50Molecular Weight (Monoisotopic): 427.1784AlogP: 6.35#Rotatable Bonds: 11Polar Surface Area: 61.56Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.87CX LogP: 5.62CX LogD: 5.62Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.16Np Likeness Score: -0.77
References 1. Gupta O, Pradhan T, Bhatia R, Monga V.. (2021) Recent advancements in anti-leishmanial research: Synthetic strategies and structural activity relationships., 223 [PMID:34171661 ] [10.1016/j.ejmech.2021.113606 ]