3-(furan-2-yl)-1-(4-((5-(quinolin-8-yloxy)pentyl)oxy)phenyl)prop-2-en-1-one

ID: ALA5190983

PubChem CID: 132280742

Max Phase: Preclinical

Molecular Formula: C27H25NO4

Molecular Weight: 427.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccco1)c1ccc(OCCCCCOc2cccc3cccnc23)cc1

Standard InChI:  InChI=1S/C27H25NO4/c29-25(16-15-23-9-6-20-31-23)21-11-13-24(14-12-21)30-18-2-1-3-19-32-26-10-4-7-22-8-5-17-28-27(22)26/h4-17,20H,1-3,18-19H2/b16-15+

Standard InChI Key:  ZGIMXCDPPOICNU-FOCLMDBBSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -6.7217   -0.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0072   -0.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2953   -0.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2953   -1.4402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0054   -1.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7217   -1.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0058    0.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2931    1.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5839    0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5797   -0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8673   -0.6139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1549   -0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4425   -0.6139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7301   -0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0177   -0.6139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3053   -0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4069   -0.6139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1195   -0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1197    0.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8304    1.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5430    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5445   -0.2004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8349   -0.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2553    1.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2553    1.8520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9678    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6802    1.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3926    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1050    1.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7217    0.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3922   -0.2723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5706   -0.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 21 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 29 28  2  0
 29 30  1  0
 30 31  2  0
 32 31  1  0
 28 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5190983

    ---

Associated Targets(non-human)

Leishmania panamensis (230 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.50Molecular Weight (Monoisotopic): 427.1784AlogP: 6.35#Rotatable Bonds: 11
Polar Surface Area: 61.56Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.87CX LogP: 5.62CX LogD: 5.62
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.16Np Likeness Score: -0.77

References

1. Gupta O, Pradhan T, Bhatia R, Monga V..  (2021)  Recent advancements in anti-leishmanial research: Synthetic strategies and structural activity relationships.,  223  [PMID:34171661] [10.1016/j.ejmech.2021.113606]

Source