The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Acetyl-7-amino-N-(2-fluoro-5-(hydroxymethyl)-3-(1-methyl-1H-pyrazol-4-yl)phenyl)indolizine-1-carboxamide ID: ALA5191045
PubChem CID: 154631660
Max Phase: Preclinical
Molecular Formula: C22H20FN5O3
Molecular Weight: 421.43
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1cc(C(=O)Nc2cc(CO)cc(-c3cnn(C)c3)c2F)c2cc(N)ccn12
Standard InChI: InChI=1S/C22H20FN5O3/c1-12(30)19-8-17(20-7-15(24)3-4-28(19)20)22(31)26-18-6-13(11-29)5-16(21(18)23)14-9-25-27(2)10-14/h3-10,29H,11,24H2,1-2H3,(H,26,31)
Standard InChI Key: WVTZLPGDOZJIRL-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
28.6581 -6.7851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6569 -7.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3650 -8.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3632 -6.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0718 -6.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0766 -7.6001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8566 -7.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3340 -7.1835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8489 -6.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1137 -8.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5704 -9.2348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9140 -8.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0968 -5.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8951 -5.5708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5465 -5.1413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1431 -4.7922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9427 -4.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1907 -3.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6401 -3.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8382 -3.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5939 -4.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2824 -2.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4448 -2.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7333 -1.6115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1311 -2.1640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4706 -2.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7962 -4.3706 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.6402 -0.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9892 -3.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5392 -4.2727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9503 -6.3767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
7 10 1 0
10 11 2 0
10 12 1 0
9 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 22 1 0
20 22 1 0
21 27 1 0
24 28 1 0
18 29 1 0
29 30 1 0
1 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.43Molecular Weight (Monoisotopic): 421.1550AlogP: 3.01#Rotatable Bonds: 5Polar Surface Area: 114.65Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.88CX Basic pKa: 1.77CX LogP: 0.80CX LogD: 0.80Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.03
References 1. Xiang Q, Wang C, Wu T, Zhang C, Hu Q, Luo G, Hu J, Zhuang X, Zou L, Shen H, Wu X, Zhang Y, Kong X, Liu J, Xu Y.. (2022) Design, Synthesis, and Biological Evaluation of 1-(Indolizin-3-yl)ethan-1-ones as CBP Bromodomain Inhibitors for the Treatment of Prostate Cancer., 65 (1.0): [PMID:34962793 ] [10.1021/acs.jmedchem.1c01864 ]
