The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenyl-phenyl)methoxy]phenyl]methylamino]heptanehydroxamic acid ID: ALA5191149
PubChem CID: 168290046
Max Phase: Preclinical
Molecular Formula: C36H39N3O4
Molecular Weight: 577.73
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(COc2ccc(CNCCCCCCC(=O)NO)c(OCc3cccc(C#N)c3)c2)cccc1-c1ccccc1
Standard InChI: InChI=1S/C36H39N3O4/c1-27-32(15-10-16-34(27)30-13-5-4-6-14-30)26-42-33-19-18-31(24-38-20-8-3-2-7-17-36(40)39-41)35(22-33)43-25-29-12-9-11-28(21-29)23-37/h4-6,9-16,18-19,21-22,38,41H,2-3,7-8,17,20,24-26H2,1H3,(H,39,40)
Standard InChI Key: MWSWGNOJFLALFM-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
-4.6334 -1.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6334 -0.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9184 0.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2033 -0.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4884 -0.0132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8009 -0.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0859 -0.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3710 -0.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3439 -0.0132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3439 0.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0592 1.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7770 0.8098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4892 1.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2041 0.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9189 0.4009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4892 2.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7729 2.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0592 2.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3710 -1.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3439 -1.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0590 -1.2232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7739 -1.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4890 -1.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2040 -1.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9187 -1.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6340 -1.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3487 -1.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0637 -1.6353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0637 -2.4607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7784 -1.2223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4934 -1.6348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0859 -1.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8009 -1.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9184 0.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6334 1.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3484 0.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3484 0.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0635 -0.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7784 -0.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4934 -0.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4934 -1.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7784 -1.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0635 -1.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 6 1 0
8 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 3 0
13 16 1 0
16 17 2 0
17 18 1 0
18 11 2 0
19 8 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 27 1 0
28 29 2 0
28 30 1 0
30 31 1 0
32 19 2 0
33 32 1 0
6 33 2 0
3 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 2 2 0
38 37 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.73Molecular Weight (Monoisotopic): 577.2941AlogP: 7.24#Rotatable Bonds: 16Polar Surface Area: 103.61Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.63CX Basic pKa: 9.23CX LogP: 6.62CX LogD: 5.67Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.07Np Likeness Score: -0.72
References 1. Xu X, Zhang D, Zhao T, Wang M, Li Y, Du Q, Kou J, Li Z, Bian J.. (2022) Novel biphenyl-based scaffold as potent and selective histone deacetylase 6 (HDAC6) inhibitors: Identification, development and pharmacological evaluation., 233 [PMID:35245830 ] [10.1016/j.ejmech.2022.114228 ]